Datasets:

blob_id
large_stringlengths
40
40
language
large_stringclasses
1 value
repo_name
large_stringlengths
5
119
path
large_stringlengths
4
271
score
float64
2.52
4.84
int_score
int64
3
5
text
stringlengths
26
4.09M
2faa6952d93bf7df2c75e4941662a34d71d6d5b3
C#
studentazz/CodeJamProject
/CodeJam/Problems/Problem1.cs
2.703125
3
using System; namespace CodeJam.Problems { public class Problem1 : IProblem { public bool IsSoved(string output) { if (output == null) return false; output = output.Trim(new char[] { '\r', '\n', ' ' }); throw new NotImplementedException(); } public string Id => "Problem1Id"; public string Input => ""; } }
8b49fd396307e78536b876df36c6d847c8c5c67c
C#
Clackgot/RIAA
/RIAA.4/Form1.cs
2.515625
3
using System; using System.Windows.Forms; namespace RIAA._4 { public partial class Form1 : Form { private Panel inputs; private Panel labels; private NumericUpDown inputA; private NumericUpDown inputB; private NumericUpDown inputEps; private NumericUpDown inputN; public Form1() { InitializeComponent(); inputs = panelInputs; labels = panelLabels; } private void Clear() { inputs.Controls.Clear(); labels.Controls.Clear(); } /// <summary> /// Метод Симпсона /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void radioButtonSimpsonMethod_CheckedChanged(object sender, EventArgs e) { Clear(); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 2), Size = new System.Drawing.Size(46, 17), Text = "Левая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 29), Size = new System.Drawing.Size(46, 17), Text = "Правая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 56), Size = new System.Drawing.Size(46, 17), Text = "Точность эпсилон", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); inputA = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0 }), Location = new System.Drawing.Point(3, -1), Maximum = new decimal(new int[] { 147483648, 0, 0, 0 }), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648 }), Size = new System.Drawing.Size(120, 22), Value = 1 }; inputB = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 26), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 2 }; inputEps = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 53), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 1 }; inputs.Controls.Add(inputA); inputs.Controls.Add(inputB); inputs.Controls.Add(inputEps); } /// <summary> /// Метод трапеций /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void radioButtonTrapezoidMethod_CheckedChanged(object sender, EventArgs e) { Clear(); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 2), Size = new System.Drawing.Size(46, 17), Text = "Левая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 29), Size = new System.Drawing.Size(46, 17), Text = "Правая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 56), Size = new System.Drawing.Size(46, 17), Text = "Число отрезков", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); inputA = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, -1), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 1 }; inputB = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 26), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 2 }; inputN = new NumericUpDown() { DecimalPlaces = 0, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 53), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 5 }; inputs.Controls.Add(inputA); inputs.Controls.Add(inputB); inputs.Controls.Add(inputN); } /// <summary> /// Метод средних треугольников /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void radioButtonMiddleRectangleMethod_CheckedChanged(object sender, EventArgs e) { Clear(); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 2), Size = new System.Drawing.Size(46, 17), Text = "Левая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 29), Size = new System.Drawing.Size(46, 17), Text = "Правая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 56), Size = new System.Drawing.Size(46, 17), Text = "Число отрезков", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 83), Size = new System.Drawing.Size(46, 17), Text = "Точность эпсилон", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); inputA = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, -1), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 1 }; inputB = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 26), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 2 }; inputN = new NumericUpDown() { DecimalPlaces = 0, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 53), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 10 }; inputEps = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 80), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = (decimal)(0.004) }; inputs.Controls.Add(inputA); inputs.Controls.Add(inputB); inputs.Controls.Add(inputN); inputs.Controls.Add(inputEps); } /// <summary> /// Метод левых треугольников /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void radioButtonLeftRectangleMethod_CheckedChanged(object sender, EventArgs e) { Clear(); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 2), Size = new System.Drawing.Size(46, 17), Text = "Левая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 29), Size = new System.Drawing.Size(46, 17), Text = "Правая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 56), Size = new System.Drawing.Size(46, 17), Text = "Точность эпсилон", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); inputA = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, -1), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 1 }; inputB = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 26), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 2 }; inputEps = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 53), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = (decimal)(0.004) }; inputs.Controls.Add(inputA); inputs.Controls.Add(inputB); inputs.Controls.Add(inputEps); } /// <summary> /// Метод правых треугольников /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void radioButtonRightRectangleMethod_CheckedChanged(object sender, EventArgs e) { Clear(); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 2), Size = new System.Drawing.Size(46, 17), Text = "Левая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 29), Size = new System.Drawing.Size(46, 17), Text = "Правая граница интегрирования", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); labels.Controls.Add(new Label() { AutoSize = true, Location = new System.Drawing.Point(0, 56), Size = new System.Drawing.Size(46, 17), Text = "Точность эпсилон", TextAlign = System.Drawing.ContentAlignment.MiddleLeft }); inputA = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, -1), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 1 }; inputB = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0}), Location = new System.Drawing.Point(3, 26), Maximum = new decimal(new int[] { 147483648, 0, 0, 0}), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648}), Size = new System.Drawing.Size(120, 22), Value = 2 }; inputEps = new NumericUpDown() { DecimalPlaces = 3, Increment = new decimal(new int[] { 0, 0, 0, 0 }), Location = new System.Drawing.Point(3, 53), Maximum = new decimal(new int[] { 147483648, 0, 0, 0 }), Minimum = new decimal(new int[] { 147483648, 0, 0, -2147483648 }), Size = new System.Drawing.Size(120, 22), Value = (decimal)(0.004) }; inputs.Controls.Add(inputA); inputs.Controls.Add(inputB); inputs.Controls.Add(inputEps); } private void button1_Click(object sender, EventArgs e) { if(radioButtonSimpsonMethod.Checked == true) { labelAnswer.Text = Lib.SimpsonMethod((double)inputA.Value, (double)inputB.Value, (double)inputEps.Value).ToString(); } else if(radioButtonTrapezoidMethod.Checked == true) { labelAnswer.Text = Lib.TrapezoidMethod((double)inputA.Value, (double)inputB.Value, (int)inputN.Value).ToString(); } else if (radioButtonLeftRectangleMethod.Checked == true) { labelAnswer.Text = Lib.LeftRectangleMethod((double)inputA.Value, (double)inputB.Value, (double)inputEps.Value).ToString(); } else if (radioButtonRightRectangleMethod.Checked == true) { labelAnswer.Text = Lib.RightRectangleMethod((double)inputA.Value, (double)inputB.Value, (double)inputEps.Value).ToString(); } else if (radioButtonMiddleRectangleMethod.Checked == true) { labelAnswer.Text = Lib.MiddleRectangleMethod((double)inputA.Value, (double)inputB.Value, (double)inputEps.Value, (int)inputN.Value).ToString(); } } } }
552943408a63133a42f24d6617e6e6f0c8301cf0
C#
sephirothwzc/Sephiroth.Common
/StringExten/SIC_Exten.cs
2.671875
3
namespace Sephiroth.Infrastructure.Common { using System; using System.Runtime.CompilerServices; using System.Security.Cryptography; using System.Text; using System.Web; using System.Web.Security; /// <summary> /// 通用字符串扩展 /// </summary> public static class SIC_Exten { /// <summary> /// 编码 /// </summary> /// <param name="str"></param> /// <param name="toType"></param> /// <returns></returns> public static string EnCode(this string str, CodeType toType = CodeType.MD5) { string str2 = str; switch (toType) { case CodeType.MD5: return GetSwcMD5(str); //return FormsAuthentication.HashPasswordForStoringInConfigFile(str, "md5"); case CodeType.SHA1: return GetSwcSH1(str); //return FormsAuthentication.HashPasswordForStoringInConfigFile(str, "SHA1"); } return str2; } private static string GetSwcSH1(string value) { SHA1 algorithm = SHA1.Create(); byte[] data = algorithm.ComputeHash(Encoding.UTF8.GetBytes(value)); string sh1 = ""; for (int i = 0; i < data.Length; i++) { sh1 += data[i].ToString("x2").ToUpperInvariant(); } return sh1; } private static string GetSwcMD5(string value) { MD5 algorithm = MD5.Create(); byte[] data = algorithm.ComputeHash(Encoding.UTF8.GetBytes(value)); string sh1 = ""; for (int i = 0; i < data.Length; i++) { sh1 += data[i].ToString("x2").ToUpperInvariant(); } return sh1; } /// <summary> /// 加密 /// </summary> /// <param name="str">字符串</param> /// <param name="key">密钥</param> /// <param name="toType">类型</param> /// <returns></returns> public static string EnCode(this string str, string key, CodeType toType = CodeType.MD5) { string str2 = str; switch (toType) { case CodeType.MD5: return GetSwcMD5(key + str); //return FormsAuthentication.HashPasswordForStoringInConfigFile(key + str, "md5"); case CodeType.SHA1: return GetSwcSH1(key + str); //return FormsAuthentication.HashPasswordForStoringInConfigFile(key + str, "SHA1"); } return str2; } //public static string GetParam(string str) //{ // if (HttpContext.Current.Request.QueryString[str] != null) // { // return HttpContext.Current.Request.QueryString[str].Replace("script", "<i>script<i>"); // } // if (HttpContext.Current.Request.Form[str] != null) // { // return HttpContext.Current.Request.Form[str].Replace("script", "<i>script<i>"); // } // return ""; //} /// <summary> /// /// </summary> /// <param name="str"></param> /// <returns></returns> public static bool NotEmpty(this string str) { return !string.IsNullOrWhiteSpace(str); } /// <summary> /// /// </summary> /// <param name="str"></param> /// <param name="def"></param> /// <returns></returns> public static double ToDouble(this string str, double def) { double num; if (double.TryParse(str, out num)) { return num; } return def; } /// <summary> /// TryParse /// </summary> /// <param name="str"></param> /// <param name="def">转换失败默认int参数</param> /// <returns></returns> public static int ToInt(this string str, int def = 0) { int num; if (int.TryParse(str, out num)) { return num; } return def; } /// <summary> /// /// </summary> /// <param name="dt"></param> /// <param name="beginTime"></param> /// <returns></returns> public static long ToTimeMs(this DateTime dt, DateTime beginTime) { long ticks = dt.Ticks - beginTime.Ticks; TimeSpan span = new TimeSpan(ticks); return (long)span.TotalMilliseconds; } /// <summary> /// /// </summary> /// <param name="date"></param> /// <returns></returns> public static string Week(string date) { string str = DateTime.Parse(date).DayOfWeek.ToString(); string str3 = str; if (str3 == null) { return str; } if (!(str3 == "Monday")) { if (str3 != "Tuesday") { if (str3 == "Wednesday") { return "星期三"; } if (str3 == "Friday") { return "星期五"; } if (str3 == "Saturday") { return "星期六"; } if (str3 != "Sunday") { return str; } return "星期日"; } } else { return "星期一"; } return "星期二"; } /// <summary> /// 编码格式 /// </summary> public enum CodeType { /// <summary> /// /// </summary> DES = 3, /// <summary> /// /// </summary> MD5 = 1, /// <summary> /// /// </summary> SHA1 = 2 } /// <summary> /// 获取中文字符串的首字母 /// </summary> /// <param name="str"></param> /// <returns></returns> public static string GetChineseSpell(this string str) { int len = str.Length; string myStr = ""; for (int i = 0; i < len; i++) { myStr += str.Substring(i, 1).getSpell(); } return myStr; } /// <summary> /// 获取单个中文的首字母 /// </summary> /// <param name="cnChar"></param> /// <returns></returns> private static string getSpell(this string cnChar) { byte[] arrCN = Encoding.Default.GetBytes(cnChar); if (arrCN.Length > 1) { int area = (short)arrCN[0]; int pos = (short)arrCN[1]; int code = (area << 8) + pos; int[] areacode = { 45217, 45253, 45761, 46318, 46826, 47010, 47297, 47614, 48119, 48119, 49062, 49324, 49896, 50371, 50614, 50622, 50906, 51387, 51446, 52218, 52698, 52698, 52698, 52980, 53689, 54481 }; for (int i = 0; i < 26; i++) { int max = 55290; if (i != 25) { max = areacode[i + 1]; } if (areacode[i] <= code && code < max) { return Encoding.Default.GetString(new byte[] { (byte)(97 + i) }); } } return "*"; } else return cnChar; } /// <summary> /// 给一个字符串进行MD5加密 /// </summary> /// <param name="strText">待加密字符串</param> /// <returns>加密后的字符串</returns> public static string MD5Encrypt(this string strText) { byte[] data = Encoding.GetEncoding("GB2312").GetBytes(strText); MD5 md5 = new MD5CryptoServiceProvider(); byte[] OutBytes = md5.ComputeHash(data); string OutString = ""; for (int i = 0; i < OutBytes.Length; i++) { OutString += OutBytes[i].ToString("x2"); } // return OutString.ToUpper(); return OutString.ToLower(); //MD5 md5 = new MD5CryptoServiceProvider(); //byte[] result = md5.ComputeHash(System.Text.Encoding.Default.GetBytes(strText)); //return System.Text.Encoding.Default.GetString(result); } } }
cde7ac7b82c8c6141718373d11f9c1f18367d762
C#
Pathoschild/smapi-mod-dump
/source/Family Planning/FamilyPlanning/ContentPackData.cs
2.90625
3
/************************************************* ** ** You're viewing a file in the SMAPI mod dump, which contains a copy of every open-source SMAPI mod ** for queries and analysis. ** ** This is *not* the original file, and not necessarily the latest version. ** Source repository: https://github.com/loe2run/FamilyPlanningMod ** *************************************************/ using System; using System.Collections.Generic; namespace FamilyPlanning { /* * I'm expanding from a ChildSpriteData Content Pack to a generic ContentPackData. * This will support child sprites and will also support dialogue for your spouse. * Details on these are below. */ class ContentPackData { /* ChildSpriteID: * -> The ChildSpriteID data structure contains the data required to pair children with their sprites. * -> The first string, the key, is the name of the child. * -> The second string, the value, is a pair of file names. First is the baby sprites, second is the toddler sprites. */ public Dictionary<string, Tuple<string, string>> ChildSpriteID { get; set; } /* BirthSpouseDialogue: * -> The BirthSpouseDialogue data structure contains dialogue information for the CustomBirthingEvent. * -> The first string, the key, is the name of the spouse you'd like it to effect. (This matches the displayName value.) * -> The second string, the value, is pair of values. * The first is the number of children where the dialogue should trigger, second is the new dialogue. * The second value, the dialogue, supports the use of {0} to represent the baby name and {1} to represent the player name. */ public Dictionary<string, List<Tuple<int, string>>> SpouseDialogue { get; set; } public ContentPackData() { ChildSpriteID = new Dictionary<string, Tuple<string, string>>(); SpouseDialogue = new Dictionary<string, List<Tuple<int, string>>>(); } } }
fc6d47dfd713fd85bfe190d23996b60117b2524d
C#
dvenkat508/OTMC
/OTMC/Classes/ServerConnection.cs
2.96875
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Net; using System.Net.Sockets; namespace OTMC.Classes { class ServerConnection { public static readonly Socket ClientSocket = new Socket(AddressFamily.InterNetwork, SocketType.Stream, ProtocolType.Tcp); public const int PORT = 975; public static bool ConnectToServer() { int count = 0; while (!ClientSocket.Connected && count<=1) { try { count++; // Change IPAddress.Loopback to a remote IP to connect to a remote host. ClientSocket.Connect("192.168.0.50", PORT); } catch (SocketException) { } } if(count>2) { return false; } else { return true; } } } }
8393cb1179c7079ac72900c9a80e64d1f7b42045
C#
MoacirSilva/googleBooks
/BooksRepo.cs
2.734375
3
using System; using System.Net.Http; using System.Net.Http.Headers; using System.Threading.Tasks; using System.Collections.Generic; using Newtonsoft.Json; namespace googleBooksApp { public class BooksRepo { public static async Task<Books> GetBookssAsync() { HttpClient client = new HttpClient(); try { string url = "https://www.googleapis.com/books/v1/volumes?q=z_JRBQAAQBAJ"; var response = await client.GetStringAsync(url); var produtos = JsonConvert.DeserializeObject <Books>(response); return produtos; } catch (Exception ex) { throw ex; } } } }
fdaa77e5288a72e4685b5fcf11bc7b3c6391af1b
C#
oldmonitor/NetDataStructure
/DataStructureProblems.Test/BacktrackingProblems/FindAllPossibleSubsetsTest.cs
2.796875
3
using DataStructureProblems.BacktrackingProblems; using Microsoft.VisualStudio.TestTools.UnitTesting; using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace DataStructureProblems.Test.BacktrackingProblems { [TestClass] public class FindAllPossibleSubsetsTest { [TestMethod] public void TestListWithJustOneItem() { FindAllPossibleSubsets c = new FindAllPossibleSubsets(); List<List<string>> result = c.HandleFindAllPossibleSubsets(new List<string>() { "a" }); Assert.AreEqual(1, result.Count); Assert.AreEqual("a", result[0][0]); } [TestMethod] public void TestListWithJustTwoItem() { FindAllPossibleSubsets c = new FindAllPossibleSubsets(); List<List<string>> result = c.HandleFindAllPossibleSubsets(new List<string>() { "a", "b", "c" }); Assert.AreEqual(7, result.Count); } } }
a38142b4c9be4efefb41683c3da4080bc477a21f
C#
ascensivetechnologies/Line-Of-Credit-Management-Platform
/AMP/z_RiskClasses/RiskDocumentCollection.cs
2.546875
3
using System; using System.Collections.Generic; using System.Linq; using System.Web; using AMP.Models; using AMP.Services; using AMP.ViewModels; namespace AMP.RiskClasses { public class RiskDocumentCollection { private IEnumerable<RiskDocument> _riskDocuments; private IDocumentService _documentService; public RiskDocumentCollection(IEnumerable<RiskDocument> riskDocuments, IDocumentService documentService) { _riskDocuments = riskDocuments; _documentService = documentService; } public IEnumerable<RiskDocument> AllRiskDocuments() { return _riskDocuments; } public bool HasRiskDocuments() { if (_riskDocuments != null && _riskDocuments.Any()) { return true; } else { return false; } } //Do something that maps the Risk Documents into a View Model. public List<RiskDocumentVM> CreateRiskDocumentsVM() { List<RiskDocumentVM> riskDocumentsVm = new List<RiskDocumentVM>(); foreach (RiskDocument document in _riskDocuments) { RiskDocumentVM documentVm = new RiskDocumentVM { ProjectID = document.ProjectID, DocumentID = document.DocumentID, Description = document.Description, DocumentLink = _documentService.ReturnDocumentUrl(document.DocumentID, document.DocSource), LastUpdate = document.LastUpdate, RiskRegisterID = document.RiskRegisterID, UserID = document.UserID }; riskDocumentsVm.Add(documentVm); } return riskDocumentsVm; } } }
50b8a67ec9700b82da6ea88baf880053c601466f
C#
fgranados1693/Coworkspaces
/ProyectoFinal/DataAccess/Crud/DocumentoCrudFactory.cs
3.09375
3
using DataAccess.Dao; using DataAccess.Mapper; using Entities_POJO; using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace DataAccess.Crud { public class DocumentoCrudFactory : CrudFactory { DocumentoMapper mapper; public DocumentoCrudFactory() : base() { mapper = new DocumentoMapper(); dao = SqlDao.GetInstance(); } /// <summary> /// Metodo para registrar el documento en la base de datos /// </summary> /// <param name="entity">Instancia del documento con la informacion recibida</param> public override void Create(BaseEntity entity) { var documento = (Documento)entity; var sqlOperation = mapper.GetCreateStatement(documento); dao.ExecuteProcedure(sqlOperation); } /// <summary> /// Metodo para buscar un documento por su id en la base de datos /// </summary> /// <param name="entity">Instancia de documento con el id del documento que se quiere buscar</param> /// <returns></returns> public override T Retrieve<T>(BaseEntity entity) { var sqlOperation = mapper.GetRetriveStatement(entity); var lstResult = dao.ExecuteQueryProcedure(sqlOperation); var dic = new Dictionary<string, object>(); if (lstResult.Count > 0) { dic = lstResult[0]; var objs = mapper.BuildObject(dic); return (T)Convert.ChangeType(objs, typeof(T)); } return default(T); } /// <summary> /// Metodo para listar todos los documentos registrados en la base de datos /// </summary> /// <returns>Lista de todos los documentos registrados en la base de datos</returns> public override List<T> RetrieveAll<T>() { var lstDocumentos = new List<T>(); var lstResult = dao.ExecuteQueryProcedure(mapper.GetRetriveAllStatement()); var dic = new Dictionary<string, object>(); if (lstResult.Count > 0) { var objs = mapper.BuildObjects(lstResult); foreach (var c in objs) { lstDocumentos.Add((T)Convert.ChangeType(c, typeof(T))); } } return lstDocumentos; } /// <summary> /// Metodo para actualizar un documento en la base de datos /// </summary> /// <param name="entity">Instancia de documento con el id del documento que se quiere actualizar</param> public override void Update(BaseEntity entity) { var documento = (Documento)entity; dao.ExecuteProcedure(mapper.GetUpdateStatement(documento)); } /// <summary> /// Metodo para eliminar un documento de la base de datos /// </summary> /// <param name="entity">Instancia de documento con el id del documento que se quiere eliminar</param> public override void Delete(BaseEntity entity) { var documento = (Documento)entity; dao.ExecuteProcedure(mapper.GetDeleteStatement(documento)); } } }
e1a7ed9226087a2aba767b4958c5d1829c838bd0
C#
Xin-Shiyu/NDictPlus
/NDictPlus/Compatibility/VersionedDictionary.cs
3
3
using System; using System.Collections; using System.Collections.Generic; using System.IO; using System.Text; using System.Linq; using System.Xml; using System.Globalization; namespace NDictPlus.Compatibility { // used for migrating from the old ndict public class VersionedDictionary : IDictionary<string, string> { private enum OperationType { Add, Set, Del, } private class Operation { public readonly OperationType Type; public readonly string Key; public readonly string Value; public Operation(OperationType type, string key, string value = null) { Type = type; Key = key; Value = value; } } private readonly Dictionary<string, string> cache = new Dictionary<string, string>(); private readonly List<Operation> operations = new List<Operation>(); public VersionedDictionary(string path) { var dir = new DirectoryInfo(path); if (!dir.Exists) dir.Create(); var files = dir .GetFiles("*.opg", SearchOption.TopDirectoryOnly) .OrderBy(file => DateTime.ParseExact( Path.GetFileNameWithoutExtension(file.Name), "yyyyMMddHHmmssffff", CultureInfo.InvariantCulture)); foreach (FileInfo file in files) { XmlDocument xml = new XmlDocument(); xml.Load(file.FullName); XmlNode root = xml.SelectSingleNode("group"); foreach (XmlElement node in root.ChildNodes) { switch (node.Name) { case "add": cache.Add(node.GetAttribute("key"), node.GetAttribute("val")); break; case "set": cache[node.GetAttribute("key")] = node.GetAttribute("val"); break; case "del": cache.Remove(node.GetAttribute("key")); break; } } } } public ICollection<string> Keys => cache.Keys; public ICollection<string> Values => cache.Values; public int Count => cache.Count; public bool IsReadOnly => false; public string this[string key] { get => cache[key]; set { cache[key] = value; operations.Add(new Operation(OperationType.Set, key, value)); } } public void Add(string key, string value) { cache.Add(key, value); operations.Add(new Operation(OperationType.Add, key, value)); } public bool ContainsKey(string key) { return cache.ContainsKey(key); } public bool Remove(string key) { if (cache.Remove(key)) { operations.Add(new Operation(OperationType.Del, key)); return true; } return false; } public bool TryGetValue(string key, out string value) { return cache.TryGetValue(key, out value); } public void Add(KeyValuePair<string, string> item) { cache.Add(item.Key, item.Value); operations.Add(new Operation(OperationType.Set, item.Key, item.Value)); } public void Clear() { foreach (var key in cache.Keys) operations.Add(new Operation(OperationType.Del, key)); cache.Clear(); } public bool Contains(KeyValuePair<string, string> item) { return ((ICollection<KeyValuePair<string, string>>)cache).Contains(item); } public void CopyTo(KeyValuePair<string, string>[] array, int arrayIndex) { ((ICollection<KeyValuePair<string, string>>)cache).CopyTo(array, arrayIndex); } public bool Remove(KeyValuePair<string, string> item) { if(((ICollection<KeyValuePair<string, string>>)cache).Remove(item)) { operations.Add(new Operation(OperationType.Del, item.Key)); return true; } return false; } public IEnumerator<KeyValuePair<string, string>> GetEnumerator() { return cache.GetEnumerator(); } IEnumerator IEnumerable.GetEnumerator() { return cache.GetEnumerator(); } } }
da1a6e5530d97ad4516f1dc539cde924366b1519
C#
guillermocorrea/ds-algos
/tests/ProblemsTests/DataStructures/Heap/MaxHeapTests.cs
3.15625
3
using Problems.DataStructures.Heap; using Xunit; namespace ProblemsTests.DataStructures.Heap { public class MaxHeapTests { [Fact] public void CanInsertMinHeap() { // Given var minHeap = new Heap<int>(int.MinValue, int.MaxValue, HeapType.MinHeap); // When minHeap.Insert(50); minHeap.Insert(45); minHeap.Insert(25); minHeap.Insert(10); minHeap.Insert(15); minHeap.Insert(40); minHeap.Insert(35); minHeap.Insert(20); minHeap.Insert(75); // Then var min = minHeap.Remove(); Assert.Equal(10, min); } [Fact] public void CanInsertMaxHeap() { // Given var maxHeap = new Heap<int>(int.MinValue, int.MaxValue, HeapType.MaxHeap); // When maxHeap.Insert(50); maxHeap.Insert(45); maxHeap.Insert(25); maxHeap.Insert(10); maxHeap.Insert(15); maxHeap.Insert(40); maxHeap.Insert(35); maxHeap.Insert(20); maxHeap.Insert(75); // Then var max = maxHeap.Remove(); Assert.Equal(75, max); } } }
842e81081d445364f9f24d58494108e3bbbb34a2
C#
Xyaneon/Xyaneon.Bioinformatics.FASTA
/Xyaneon.Bioinformatics.FASTA.Test/Identifiers/ThirdPartyEMBLIdentifierTest.cs
2.703125
3
using Microsoft.VisualStudio.TestTools.UnitTesting; using System; using Xyaneon.Bioinformatics.FASTA.Identifiers; namespace Xyaneon.Bioinformatics.FASTA.Test.Identifiers { [TestClass] public class ThirdPartyEMBLIdentifierTest { private const string Code = "tpe"; private const string Accession = "accession"; private const string Name = "name"; [TestMethod] [ExpectedException(typeof(ArgumentNullException))] public void Constructor_ShouldRejectNullAccessionNumber() { _ = new ThirdPartyEMBLIdentifier(null, Name); } [TestMethod] [ExpectedException(typeof(ArgumentException))] public void Constructor_ShouldRejectEmptyAccessionNumber() { _ = new ThirdPartyEMBLIdentifier("", Name); } [TestMethod] [ExpectedException(typeof(ArgumentException))] public void Constructor_ShouldRejectWhitespaceAccessionNumber() { _ = new ThirdPartyEMBLIdentifier(" ", Name); } [TestMethod] [ExpectedException(typeof(ArgumentNullException))] public void Constructor_ShouldRejectNullName() { _ = new ThirdPartyEMBLIdentifier(Accession, null); } [TestMethod] [ExpectedException(typeof(ArgumentException))] public void Constructor_ShouldRejectEmptyName() { _ = new ThirdPartyEMBLIdentifier(Accession, ""); } [TestMethod] [ExpectedException(typeof(ArgumentException))] public void Constructor_ShouldRejectWhitespaceName() { _ = new ThirdPartyEMBLIdentifier(Accession, " "); } [TestMethod] public void Code_ShouldReturnCorrectValue() { Identifier identifier = new ThirdPartyEMBLIdentifier(Accession, Name); Assert.AreEqual(Code, identifier.Code); } [TestMethod] public void ToString_ShouldFormatCorrectly() { Identifier identifier = new ThirdPartyEMBLIdentifier(Accession, Name); Assert.AreEqual($"{Code}|{Accession}|{Name}", identifier.ToString()); } } }
a10bf84bde1bc68a1440101d90bf307a78a6e6a0
C#
AdamBallinger/Fragmentum
/Assets/Scripts/Objects/BatBoss/GateController.cs
2.546875
3
using System.Collections; using UnityEngine; namespace Assets.Scripts.Objects.BatBoss { public class GateController : MonoBehaviour { public float moveSpeed = 1.0f; public float closeDistance = 1.0f; private bool isClosed; private Vector3 openPos = Vector3.zero; private bool runtime; private Transform _transform; private void Start() { _transform = transform; runtime = true; openPos = _transform.position; } public void CloseGate() { if (isClosed) { return; } isClosed = true; StartCoroutine(Close()); } private IEnumerator Close() { var pos = _transform.position; var closePos = pos - Vector3.down * closeDistance; while (true) { pos = Vector3.MoveTowards(pos, closePos, moveSpeed * Time.deltaTime); _transform.position = pos; if(pos == closePos) { yield break; } yield return null; } } private void OnDrawGizmos() { var bottom = transform.position + Vector3.down * GetComponent<BoxCollider>().bounds.size.y / 2; var closePos = (runtime ? openPos : transform.position) - Vector3.down * closeDistance; closePos.y -= GetComponent<BoxCollider>().bounds.size.y / 2; Gizmos.color = Color.green; Gizmos.DrawLine(bottom, closePos); } } }
e74b080a057c476a95c8cc2cbcac83a11aa26f23
C#
Andi11449/mathnet-numerics
/src/Numerics/LinearAlgebra/Matrix.Indexing.cs
3.125
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; namespace MathNet.Numerics.LinearAlgebra { public abstract partial class Matrix<T> { public Vector<T> this[int row, Indexer columns] { get { columns.Init(ColumnCount); var target = Vector<T>.Build.Dense(columns.Count); for (var i = 0; i < columns.Count; i++) { target[i] = this[row, columns[i]]; } return target; } set { columns.Init(ColumnCount); if (value.Count != 1 && value.Count != columns.Count) { throw new ArgumentOutOfRangeException("The number of elements must match the number of indexed columns"); } if (value.Count == 1) { var v = value[0]; foreach (var column in columns) { this[row, column] = v; } } else { for (var i = 0; i < columns.Count; i++) { this[row, columns[i]] = value[i]; } } } } public Vector<T> this[Indexer rows, int column] { get { rows.Init(RowCount); var target = Vector<T>.Build.Dense(rows.Count); for (var i = 0; i < rows.Count; i++) { target[i] = this[rows[i], column]; } return target; } set { rows.Init(RowCount); if (value.Count != 1 && value.Count != rows.Count) { throw new ArgumentOutOfRangeException("The number of elements must match the number of indexed rows"); } if (value.Count == 1) { var v = value[0]; foreach (var row in rows) { this[row, column] = v; } } else { for (var i = 0; i < rows.Count; i++) { this[rows[i], column] = value[i]; } } } } public Matrix<T> this[Indexer rows, Indexer columns] { get { rows.Init(RowCount); columns.Init(ColumnCount); var target = Build.Dense(rows.Count, columns.Count); for (var col = 0; col < columns.Count; col++) { for (var row = 0; row < rows.Count; row++) { target[row, col] = this[rows[row], columns[col]]; } } return target; } set { rows.Init(RowCount); columns.Init(ColumnCount); if (value.ColumnCount != 1 && value.ColumnCount != columns.Count) { throw new ArgumentOutOfRangeException("The number of elements must match the number of indexed columns"); } if (value.RowCount != 1 && value.RowCount != rows.Count) { throw new ArgumentOutOfRangeException("The number of elements must match the number of indexed rows"); } if (value.RowCount == 1 && value.ColumnCount == 1) { var v = value[0, 0]; foreach (var row in rows) { foreach (var column in columns) { this[row, column] = v; } } } else { for (var ci = 0; ci < columns.Count; ci++) { for (var ri = 0; ri < rows.Count; ri++) { this[rows[ri], columns[ci]] = value[ri, ci]; } } } } } } }
3bd1a66067634aa57187abf5b44057bd156bfd20
C#
discord-net/Discord.Net
/docs/guides/entities/samples/safety-cast-pass.cs
3.296875
3
private void MyFunction(IMessage message) { // Here we do the reverse as in the previous examples, and let it continue the code below if it IS an IUserMessage if (message is not IUserMessage userMessage) return; // Because we do the above check inline (don't give the statement a body), // the code will still declare `userMessage` as available outside of the above statement. Console.WriteLine(userMessage.Author); }
f3e73ea758b020950eb4bc04301d6cb34632a032
C#
Khantastic96/Hemorrhage
/Hemorrhage/Assets/Project/Scripts/Game/ForceReceiver.cs
2.6875
3
/** * Created DD/MM/2020 * By: Sharek Khan * Last Modified DD/MM/2020 * By: Sharek Khan * * Contributors: Sharek Khan */ using UnityEngine; /* * ForceReceiver applies a kickback force to a GameObject containing the CharacterController Component * Code based on Zenva Studios -COMPLETE COURSE Create a Unity FPS Game in 3 hours - https://www.youtube.com/watch?v=UtlAqRyZrUw */ public class ForceReceiver : MonoBehaviour { public float deceleration = 5; public float mass = 3; private Vector3 intensity; private CharacterController character; // Start is called before the first frame update void Start() { intensity = Vector3.zero; character = GetComponent<CharacterController>(); } // Update is called once per frame void Update() { // Condition checks if magnitude of the forces intensity is below a float value if(intensity.magnitude > 0.2f) { // Translates the character in a specific vector with the force intensity character.Move(intensity * Time.deltaTime); } intensity = Vector3.Lerp(intensity, Vector3.zero, deceleration * Time.deltaTime); } // AddForce receives a vector and force amount and defines the intensity relative to mass public void AddForce(Vector3 direction, float force) { intensity += direction.normalized * force / mass; } }
858f67605d137da66bf1399ce47b836ea8bcc265
C#
dotnet/efcore
/src/EFCore/Diagnostics/LoggerCategory.cs
2.5625
3
// Licensed to the .NET Foundation under one or more agreements. // The .NET Foundation licenses this file to you under the MIT license. namespace Microsoft.EntityFrameworkCore.Diagnostics; /// <summary> /// Generic helper class used to implement the <see cref="Name" /> property. /// </summary> /// <remarks> /// See <see href="https://aka.ms/efcore-docs-diagnostics">Logging, events, and diagnostics</see> for more information and examples. /// </remarks> /// <typeparam name="T">The logger category type.</typeparam> public abstract class LoggerCategory<T> { /// <summary> /// The logger category name, for use with <see cref="ILoggerProvider" />, etc. /// </summary> /// <returns>The category name.</returns> public static string Name { get; } = ToName(typeof(T)); /// <summary> /// The logger category name. /// </summary> /// <returns>The logger category name.</returns> public override string ToString() => Name; /// <summary> /// The logger category name. /// </summary> /// <param name="loggerCategory">The category.</param> public static implicit operator string(LoggerCategory<T> loggerCategory) => loggerCategory.ToString(); private static string ToName(Type loggerCategoryType) { const string outerClassName = "." + nameof(DbLoggerCategory); var name = loggerCategoryType.FullName!.Replace('+', '.'); var index = name.IndexOf(outerClassName, StringComparison.Ordinal); if (index >= 0) { name = name[..index] + name[(index + outerClassName.Length)..]; } return name; } }
428736cf35c11e6b893998fff49f492eaa382b19
C#
NickOosterhuis/FriendshipBenchCleanBack
/WebApi/Seeders/UserRoleSeeder.cs
2.609375
3
using Microsoft.AspNetCore.Identity; using System; using System.Collections.Generic; using System.Linq; using System.Threading.Tasks; namespace WebApi.Seeders { public class UserRoleSeeder { private readonly RoleManager<IdentityRole> _roleManager; public UserRoleSeeder(RoleManager<IdentityRole> roleManager) { this._roleManager = roleManager; } public async void SeedRoles() { var adminRoleBool = _roleManager.RoleExistsAsync("admin").Result; var clientRoleBool = _roleManager.RoleExistsAsync("client").Result; var healthWorkerRoleBool = _roleManager.RoleExistsAsync("healthworker").Result; if(!adminRoleBool) await _roleManager.CreateAsync(new IdentityRole("admin")); if(!healthWorkerRoleBool) await _roleManager.CreateAsync(new IdentityRole("healthworker")); if(!clientRoleBool) await _roleManager.CreateAsync(new IdentityRole("client")); } } }
d56a267a3e06cc7564a493725f0cb275b6a37018
C#
naik899/ReadTextFromImage
/ReadFromImage/Helpers/ImageParser.cs
3.0625
3
using System; using System.Collections.Generic; using System.Drawing; using System.Linq; using System.Text; using System.Threading.Tasks; using Tesseract; namespace ReadFromImage.Helpers { public class ImageParser { internal static string GetTextFromImage(Bitmap imgsource) { try { var ocrtext = string.Empty; var tessdataPath = string.Empty; // this should contain the tess data in the folder tessdata var engine = new TesseractEngine(tessdataPath, "eng"); using (var img = PixConverter.ToPix(imgsource)) { using (var page = engine.Process(img)) { ocrtext = page.GetText(); } } return ocrtext; } catch (Exception ex) { Console.WriteLine("Exception at GetTextFromImage: " + ex.ToString()); return ex.ToString(); } } } }
a5a537aeebfea9a4d0ceea626bccc8b5b7d81984
C#
zzattack/munia
/MUNIA-win/SVG#/External/ExCSS/Model/TextBlocks/StringBlock.cs
3.21875
3
 namespace ExCSS.Model.TextBlocks { internal class StringBlock : Block { StringBlock(GrammarSegment type) { GrammarSegment = type; } internal static StringBlock Plain(string data, bool bad = false) { return new StringBlock(GrammarSegment.String) { Value = data, IsBad = bad }; } internal static StringBlock Url(string data, bool bad = false) { return new StringBlock(GrammarSegment.Url) { Value = data, IsBad = bad }; } internal string Value { get; private set; } internal bool IsBad { get; private set; } public override string ToString() { if (GrammarSegment == GrammarSegment.Url) { return "url(" + Value + ")"; } return "'" + Value + "'"; } } }
54f177ba48d9fb62402b5fe54d0f7b67280daa25
C#
Gustice/Public-Status-Indicator
/PublicStatusIndicator/Webserver/RequestParser.cs
3.078125
3
using System; using System.Net; using System.Text; using System.Text.RegularExpressions; namespace PublicStatusIndicator.Webserver { internal static class RequestParser { /// <summary> /// Tries to get the (Basic) authorisation credentials out of the given request string /// </summary> /// <param name="requestString">the request string wich contains the basic auth info </param> /// <returns><see cref="NetworkCredential"/></returns> public static NetworkCredential GetCredentials(string requestString) { if (string.IsNullOrWhiteSpace(requestString)) throw new ArgumentException(nameof(requestString)); var authRegex = new Regex(@"\b(Basic).[^\s]+"); var user = authRegex.Match(requestString); var encodedUsernamePassword = user.Value.Substring("Basic ".Length).Trim(); var encoding = Encoding.GetEncoding("iso-8859-1"); var usernamePassword = encoding.GetString(Convert.FromBase64String(encodedUsernamePassword)); if (string.IsNullOrEmpty(usernamePassword)) throw new Exception("Auth Error"); if (!usernamePassword.Contains(":")) throw new Exception("Auth Error"); return new NetworkCredential() { UserName = usernamePassword.Split(':')[0], Password= usernamePassword.Split(':')[1] }; } } }
ae7c6347affb3e605a76ca630f3d23a3043f921f
C#
userv/programming-fundamentals
/exercises/ObjectsAndSimpleClasses-MoreExercises/4.Websites/Websites.cs
3.5
4
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace _4.Websites { class Websites { public class Website { public string Host { get; set; } public string Domain { get; set; } public List<string> Queries = new List<string>(); } public static Website AddWebsite(string websiteData) { string[] tokens = websiteData.Split(new char[] { ' ', '|', ',' }, StringSplitOptions.RemoveEmptyEntries).ToArray(); string host = tokens[0]; string domain = tokens[1]; List<string> queries = tokens.Skip(2).ToList(); Website website = new Website { Host = host, Domain = domain, Queries = queries }; return website; } static void Main(string[] args) { List<Website> websites = new List<Website>(); string inputLine = Console.ReadLine(); while (inputLine != "end") { websites.Add(AddWebsite(inputLine)); inputLine = Console.ReadLine(); } foreach (var website in websites) { if (website.Queries.Count < 1) { Console.WriteLine($"https://www.{website.Host}.{website.Domain}"); } else { Console.Write($"https://www.{website.Host}.{website.Domain}/query?="); for (int i = 0; i < website.Queries.Count; i++) { if (i == 0) { Console.Write($"[{website.Queries[i]}]"); } else { Console.Write($"&[{website.Queries[i]}]"); } } Console.WriteLine(); } } } } }
f34a6ea3695ce37ae4b77cfd4d4da601b31e6945
C#
ArturTrainee/programing.term4
/Lab3/Exercise8And9/RegistrationForm.cs
2.90625
3
using System; using System.Drawing; using System.Windows.Forms; namespace Lab3.Exercise8And9 { public partial class RegistrationForm : Form { public RegistrationForm() { InitializeComponent(); } private void CheckBox1_CheckedChanged(object sender, EventArgs e) { if (checkBox1.Checked) { var lb1 = new Label(); lb1.Location = new Point(6, 74); lb1.Size = new Size(32, 23); lb1.Name = "labelll"; lb1.TabIndex = 2; lb1.Text = "PIN2"; groupBox1.Controls.Add(lb1); var txt = new TextBox(); txt.Location = new Point(64, 74); txt.Size = new Size(140, 22); txt.Name = "textboxx"; txt.TabIndex = 1; txt.Text = ""; txt.KeyPress += TextBox2_KeyPress; groupBox1.Controls.Add(txt); } else { int lcv = groupBox1.Controls.Count; while (lcv > 4) { groupBox1.Controls.RemoveAt(lcv - 1); lcv--; } } } private void TextBox1_KeyPress(object sender, KeyPressEventArgs e) { if (char.IsDigit(e.KeyChar)) { e.Handled = true; MessageBox.Show("Поле Name не може містити цифри"); errorProvider1.SetError(textBox1, "Must be letter"); } } private void TextBox2_KeyPress(object sender, KeyPressEventArgs e) { if (!char.IsDigit(e.KeyChar)) { e.Handled = true; MessageBox.Show("Поле PIN може містити лише цифри"); errorProvider1.SetError(textBox2, "Must be digit"); } } private void TextBox2_Validating(object sender, System.ComponentModel.CancelEventArgs e) { if (string.IsNullOrEmpty(textBox2.Text)) { e.Cancel = false; } else { try { double.Parse(textBox2.Text); e.Cancel = false; } catch { e.Cancel = true; MessageBox.Show("Поле PIN не може містити букви"); } } } } }
7761523f0eb806c7c7c244ac8dbd0e172cd12e90
C#
glcherepanov/rp
/ds-3/JobLogger/RedisDbContext.cs
2.984375
3
using System; using System.Collections.Generic; using System.IO; using System.Text; using Microsoft.Extensions.Configuration; using StackExchange.Redis; namespace JobLogger { class RedisDbContext { public static string GetDesription(string id) { string currentDirectoryPath = Directory.GetCurrentDirectory(); string jsonPath = Directory.GetParent(currentDirectoryPath) + "/config/config.json"; var config = new ConfigurationBuilder() .SetBasePath(Directory.GetCurrentDirectory()) .AddJsonFile(jsonPath, optional: false) .Build(); ConnectionMultiplexer redis = ConnectionMultiplexer.Connect($"localhost:{config.GetValue<int>("RedisPort")}"); IDatabase db = redis.GetDatabase(); string description = db.StringGet(id); return description; } } }
3b417c9e4c98534c0a6b15d784a69b0824c576ac
C#
tolgasavass/yazilimGelistirmeKampi
/myDictionary/myDictionary/myList.cs
3.21875
3
using System; using System.Collections.Generic; using System.Text; namespace myDictionary { class myList<Tip> { Tip[] array; Tip[] tempArray; public myList() { array = new Tip[0]; } public void Add(Tip item, string v) { tempArray = array; array = new Tip[array.Length + 1]; for (int i = 0; i < tempArray.Length; i++) { array[i] = tempArray[i]; } array[array.Length - 1] = item; } public int Sayac { get { return array.Length; } } } }
1651c9421745cf6321fc38b9ec43a3ffe61e768e
C#
ikedatatsuya0802/Ongaku_Game
/Shooting_Game/Assets/Script/SingletonMonoBehaviour.cs
3.046875
3
using System.Collections; using UnityEngine; /// <summary> /// MonoBehaviourのシングルトン対応クラス /// </summary> public class SingletonMonoBehaviour<T> : MonoBehaviour where T : SingletonMonoBehaviour<T> { protected static T instance; /// <summary> ///インスタンスのゲッター /// </summary> /// <returns>クラスインスタンス</returns> public static T Instance { get{ if(instance == null) { instance = (T)FindObjectOfType(typeof(T)); if( instance == null) { //基本的にここは通らないはず Debug.LogWarning(typeof(T)+"は存在しません"); } } return instance; } } protected void Awake() { CheckInstance(); } /// <summary> /// インスタンスが存在するか確認し、存在しない場合は自身のインスタンスを使用する /// 存在してる場合は自身のオブジェクトを破棄する /// </summary> /// <returns>自身を使用する場合true</returns> protected bool CheckInstance() { if( instance == null) { instance = (T)this; return true; }else if (Instance == this) { return true; } Destroy(this); return false; } }
52ebfdcce195098a8e5d9364b2bc3c6a9d33f916
C#
anotherlab/thedoctors-deprecated
/Doctors/Doctors.iPhone/DetailViewController.cs
2.515625
3
using System; using System.Drawing; using System.Collections.Generic; using MonoTouch.Foundation; using MonoTouch.UIKit; using Doctors.Models; namespace Doctors.iPhone { public partial class DetailViewController : UIViewController { DoctorActor detailItem; private UILabel ActorLabel, Actor, IncarnationLabel, Incarnation, StartDateLabel, StartDate, AgeLabel, Age; public DetailViewController(IntPtr handle) : base(handle) { float dy = 20f; float dyy = 24f; float y = 260f; var labelsize = 12f; var textside = 18f; Title = "DetailsTitle".t(); ActorLabel = MakeLabel("Actor".t(), y, labelsize); y += dy; Actor = MakeLabel("Actor".t(), y, textside); y += dyy; IncarnationLabel = MakeLabel("Incarnation".t(), y, labelsize); y += dy; Incarnation = MakeLabel("Actor".t(), y, textside); y += dyy; StartDateLabel = MakeLabel("StartDate".t(), y, labelsize); y += dy; StartDate = MakeLabel("Actor".t(), y, textside); y += dyy; AgeLabel = MakeLabel("AgeAtStart".t(), y, labelsize); y += dy; Age = MakeLabel("Actor".t(), y, textside); } public void SetDetailItem(DoctorActor newDetailItem) { if (detailItem != newDetailItem) { detailItem = newDetailItem; // Update the view ConfigureView(); } } private UILabel MakeLabel(string Caption, float y, float size) { var label = new UILabel() { Text = Caption, Font = UIFont.FromName("TrebuchetMS", size), Frame = new RectangleF(10, y, 250, 25) }; View.Add(label); return label; } void ConfigureView() { // Update the user interface for the detail item if (IsViewLoaded && (detailItem != null)) { photo.Image = UIImage.FromBundle("images/" + detailItem.ImageUrl); Actor.Text = detailItem.Actor; Incarnation.Text = detailItem.Incarnation; StartDate.Text = detailItem.StartDate.ToShortDateString (); Age.Text = detailItem.Age.ToString (); } } public override void DidReceiveMemoryWarning() { // Releases the view if it doesn't have a superview. base.DidReceiveMemoryWarning(); // Release any cached data, images, etc that aren't in use. } public override void ViewDidLoad() { base.ViewDidLoad(); // Perform any additional setup after loading the view, typically from a nib. ConfigureView(); } } }
73dca3f3b2949ac3aceecb1086ad8558f0c8f369
C#
zleao/MvvmCross-Extensions
/Libraries/MvxExtensions/Extensions/AssemblyExtensions.cs
3.0625
3
using System.Reflection; namespace MvxExtensions.Extensions { /// <summary> /// Extensions for Assembly type /// </summary> public static class AssemblyExtensions { /// <summary> /// Gets the name of the assembly. /// Deals with null source /// </summary> /// <param name="source">The source.</param> /// <returns></returns> public static AssemblyName SafeGetName(this Assembly source) { if (source == null) return null; return new AssemblyName(source.FullName); } } }
a690780487e69372b84ad56ff4f8ba576f14ab26
C#
AlexandRLV/SomeUniversityWork
/AdoNetApp1/AdoNetApp1/EditCategoryForm.cs
3.046875
3
using System; using System.Collections.Generic; using System.ComponentModel; using System.Data; using System.Drawing; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Windows.Forms; using AdoNetApp1.Models; namespace AdoNetApp1 { public partial class EditCategoryForm : Form { // Категория, с которой работаем private Category category; public EditCategoryForm(FormType type, Category c) { // Сохраняем полученную категорию this.category = c; InitializeComponent(); label6.Text = ""; if (category == null) { category = new Category(); } // Записываем значения полей if (type == FormType.Update) { textBox1.Text = c.Name; button1.Text = "Применить"; this.Text = "Изменить"; } if (type == FormType.Create) { button1.Text = "Добавить"; this.Text = "Добавить"; } } // Сохранение изменений private void button1_Click(object sender, EventArgs e) { // Флаг для проверки корректности полей bool flag = true; // Проверка названия if (String.IsNullOrWhiteSpace(textBox1.Text)) { label6.Text = "Некорректное название"; flag = false; } else if (textBox1.Text.Length > 50) { label6.Text = "Максимум 50 символов"; flag = false; } else { label6.Text = ""; } // Если все поля корректны, сохраняем изменения if (flag) { category.Name = textBox1.Text; this.Close(); } } } }
716d3ec5147f518b68bc6b7fc0179ab27c675d77
C#
jimolle/MVCDesignmonster
/MVCDesignmonster.Test/BusinessObjectsTests/EmployerRepositoryTests.cs
2.734375
3
using System; using System.Collections.Generic; using System.Linq; using System.Linq.Expressions; using Microsoft.VisualStudio.TestTools.UnitTesting; using MVCDesignmonster.BusinessObjects.Models; using MVCDesignmonster.BusinessObjects.Repository; using MVCDesignmonster.Test.Fakes; namespace MVCDesignmonster.Test.BusinessObjectsTests { [TestClass] public class EmployerRepositoryTests { private IEmployerRepository _repo; public EmployerRepositoryTests() { //_repo = new EmployerRepository(new ProfileDbContext()); _repo = new FakeEmployerRepository(); } [TestMethod] public void GetPublicEmployers() { // Arrange var educ = _repo.GetPublicEmployers(); // Act int count = 1; // Assert Assert.AreEqual(count, educ.Count()); } [TestMethod] public void UpdateEmployer() { // Arrange var emp = _repo.GetAllEmployersEvenPrivate().SingleOrDefault(n => n.EmployerId == 2); // Act emp.Name = "UPDATED"; emp.StartDate = DateTime.Parse("3000-01-01"); emp.EndDate = DateTime.Parse("3001-01-01"); emp.Public = false; _repo.UpdateEmployer(emp); _repo.Save(); // Assert Assert.AreEqual(emp.Name, _repo.GetAllEmployersEvenPrivate().SingleOrDefault(n => n.EmployerId == 2).Name); } [TestMethod] public void CreateEmployer() { // Arrange // Act var emp = new Employer() { Name = "NewEmployer", StartDate = DateTime.Parse("2013-01-01"), EndDate = DateTime.Parse("2013-06-01"), Public = true }; _repo.CreateEmployer(emp); _repo.Save(); // Assert Assert.AreEqual(emp.Name, _repo.GetAllEmployersEvenPrivate().SingleOrDefault(n => n.Name == "NewEmployer").Name); } [TestMethod] public void DeleteEmployer() { // Arrange // Act _repo.DeleteEmployer(1); _repo.Save(); // Assert Assert.IsNull(_repo.GetAllEmployersEvenPrivate().SingleOrDefault(n => n.EmployerId == 1)); } } }
d4f14ff67f17fe73d2834d687d0183ff9cb6cdf2
C#
zhangmeng1226/Mohawk_Battleship
/Bots CSharp/DaveBot_1_4_5/HuntingMap.cs
2.65625
3
using MBC.Shared; using System; using System.Collections.Generic; using System.Linq; using System.Text; namespace MBC.Controllers.DaveBot_1_4_5 { class HuntingMap : ProbabilityMap { protected const bool RESET_HUNTING_ON_SINK = true; // Wipes hunting mode memory when a ship is sunk, if false, protected const bool REDUCE_PROBABILITY_ON_SINK = false; // Treats sinks as a miss and reduces hunting probability as such public HuntingMap(int size, int[] shipLengths, CellStateMap cellStateMap) : base(size, shipLengths, cellStateMap) { this.weighted = 50; } public void shipSunk(Coordinates coords) { if (RESET_HUNTING_ON_SINK) { //should not exist, probability reducing should be better this.reset(); } // Pointless if hunting was just reset if (REDUCE_PROBABILITY_ON_SINK) { this.removeHuntingProbability(coords); } } public void addHuntingProbability(Coordinates coords) { List<List<Coordinates>> coordsLists; int maxLength; coordsLists = ShotHelper.getSurrounding(coords, shipLengths.Max() - 1); foreach (List<Coordinates> coordList in coordsLists) { maxLength = howManyFree(coordList) + 1; // how many sequential spaces are available in these coordinates addProbabilitiy(coords, coordList, maxLength); } } public void removeHuntingProbability(Coordinates coords) { List<List<Coordinates>> coordsLists; int maxLength; coordsLists = ShotHelper.getSurrounding(coords, shipLengths.Max() - 1); foreach (List<Coordinates> coordList in coordsLists) { maxLength = howManyFree(coordList) + 1; removeProbabilitiy(coordList, maxLength); } } } }
28a9c32eeb99d962b612a483d80c72dc12823181
C#
quanliang2000/eventbus
/examples/InMemoryUnitTest/SimplePublisherTests.cs
2.5625
3
using Microsoft.Extensions.DependencyInjection; using Microsoft.Extensions.Hosting; using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; using Tingle.EventBus; using Tingle.EventBus.Transports.InMemory; using Xunit; namespace InMemoryUnitTest { public class SimplePublisherTests { // This unit test applies when you have an implementation that does not call the event publisher directly [Theory] [InlineData(1)] [InlineData(6)] public async Task EventIsPublishedOnBysAsync(int orderNumber) { var services = new ServiceCollection() .AddLogging() .AddSingleton<IHostEnvironment, FakeHostEnvironment>() .AddEventBus(builder => builder.AddInMemoryTransport().AddInMemoryTestHarness()) .AddSingleton<RandomOrderProcessor>(); var provider = services.BuildServiceProvider(); var harness = provider.GetRequiredService<InMemoryTestHarness>(); await harness.StartAsync(); try { var orderProcessor = provider.GetRequiredService<RandomOrderProcessor>(); await orderProcessor.ProcessAsync(orderNumber); // expect publish for event order numbers if ((orderNumber % 2) == 0) { // Ensure no failures Assert.False(harness.Failed().Any()); // Ensure only one was published var context = Assert.Single(harness.Published<OrderProcessedEvent>()); var evt = context.Event; Assert.Equal(2021 + orderNumber, evt.Year); } else { // Ensure no failures Assert.False(harness.Failed().Any()); // Ensure nothing was published Assert.False(harness.Published().Any()); } } finally { await harness.StopAsync(); } } class OrderProcessedEvent : SimpleConsumer.SampleEvent { } class RandomOrderProcessor { private readonly IEventPublisher publisher; public RandomOrderProcessor(IEventPublisher publisher) { this.publisher = publisher ?? throw new ArgumentNullException(nameof(publisher)); } public async Task ProcessAsync(int orderNumber) { // only publish if the order number is even (can be any other condition) if ((orderNumber % 2) == 0) { await publisher.PublishAsync(new OrderProcessedEvent { Make = "TESLA", Model = "Roadster 2.0", Registration = "1234567890", VIN = "5YJ3E1EA5KF328931", Year = 2021 + orderNumber, }); } } } } }
a3e5bbfd5fb2b377d839413b995a7a5f698f6eb4
C#
bytting/gammalab
/GammaGUI/FormGammaGUI_ShowText.cs
2.765625
3
using System; using System.Collections.Generic; using System.ComponentModel; using System.Data; using System.Drawing; using System.Drawing.Printing; using System.Linq; using System.Text; using System.Windows.Forms; namespace GammaGUI { public partial class FormGammaGUI_ShowText : Form { private bool mUseDefaultPrinter = false; public FormGammaGUI_ShowText(bool useDefaultPrinter) { InitializeComponent(); mUseDefaultPrinter = useDefaultPrinter; } public void setContent(string content) { textBoxContent.Text = content.Replace((char)0, ' '); textBoxContent.SelectionStart = 0; textBoxContent.SelectionLength = 0; } private void buttonClose_Click(object sender, EventArgs e) { Close(); } private void buttonPrint_Click(object sender, EventArgs e) { try { PrintDialog pd = new PrintDialog(); pd.PrinterSettings = new PrinterSettings(); MultipadPrintDocument printDoc = new MultipadPrintDocument(); if (mUseDefaultPrinter) { if (!pd.PrinterSettings.IsValid) if (pd.ShowDialog() != DialogResult.OK) return; } else { if (pd.ShowDialog() != DialogResult.OK) return; } printDoc.PrinterSettings = pd.PrinterSettings; printDoc.Font = textBoxContent.Font; printDoc.Text = textBoxContent.Text; printDoc.Print(); } catch (Exception ex) { MessageBox.Show("Printing failed. Make sure a printer is online and available", "Message"); } } private void buttonFind_Click(object sender, EventArgs e) { FormGammaGUI_Find form = new FormGammaGUI_Find(); if (form.ShowDialog() != System.Windows.Forms.DialogResult.OK) return; try { int pos, startPos; Point x = textBoxContent.GetPositionFromCharIndex(textBoxContent.SelectionStart); pos = textBoxContent.GetCharIndexFromPosition(x); startPos = textBoxContent.Text.IndexOf(form.Token, pos, StringComparison.OrdinalIgnoreCase); if (!(startPos > 0)) { MessageBox.Show("Search text: '" + form.Token + "' could not be found", "Text Not Found", MessageBoxButtons.OK, MessageBoxIcon.Asterisk); return; } else { textBoxContent.Select(startPos, form.Token.Length); textBoxContent.ScrollToCaret(); textBoxContent.Focus(); } } catch (Exception ex) { MessageBox.Show(ex.Message, "Search Error"); } } } }
6bf51d3b0a9f48388893aa15cffe40d9d0b7a0ac
C#
Herdubreid/Celin.AIS.Data
/src/Literal.cs
2.53125
3
using Pidgin; using System.Collections.Generic; using System.Text.RegularExpressions; using static Pidgin.Parser; namespace Celin.AIS.Data { public class Literal { public static readonly Regex VARIABLE = new Regex(@"^%VARIABLE:(\w+)(?>\[(\d+)\])?:%"); static readonly Parser<char, int> Index = Try(DecimalNum.Between(Char('['), Char(']'))); static readonly Parser<char, string> VariableName = Try(Char('@')) .Then(LetterOrDigit .ManyString(), (h, t) => t); static readonly Parser<char, string> Variable = Map((name, index) => $"%VARIABLE:{name}{(index.HasValue ? $"[{index.Value}]" : string.Empty)}:%", VariableName, Index.Optional()); static readonly Parser<char, string> Plain = Try(LetterOrDigit) .Then(LetterOrDigit .ManyString(), (h, t) => h + t); public static readonly Parser<char, string> Quoted = AnyCharExcept('"') .ManyString() .Between(Char('"')); public static Parser<char, string> Parser => Plain .Or(Variable) .Or(Quoted) .Labelled("Literal"); public static Parser<char, IEnumerable<string>> Array => Parser .SeparatedAtLeastOnce(Char(',')) .Labelled("Literal Array"); } }
d7edbad8877ba9535b3f7fa8e737fc5069230b95
C#
shendongnian/download4
/code5/937870-23602620-64906815-2.cs
2.5625
3
private async void ResponseCallback(IAsyncResult asyncres) { try { HttpWebRequest wreq = (HttpWebRequest)asyncres.AsyncState; HttpWebResponse wres = (HttpWebResponse)wreq.EndGetResponse(asyncres); StreamReader sr = new StreamReader(wres.GetResponseStream()); string result = await sr.ReadToEndAsync(); //HTML View Deployment.Current.Dispatcher.BeginInvoke(() => { HTML.Text = result; }); //Readable string read; read = Regex.Replace(result, "<script.*?</script>", "", RegexOptions.Singleline | RegexOptions.IgnoreCase); read = Regex.Replace(read, "<style.*?</style>", "", RegexOptions.Singleline | RegexOptions.IgnoreCase); read = Regex.Replace(read, "</?[a-z][a-z0-9]*[^<>]*>", ""); read = Regex.Replace(read, "<!--(.|\\s)*?-->", ""); read = Regex.Replace(read, "<!(.|\\s)*?>", ""); read = Regex.Replace(read, "[\t\r\n]", " "); Deployment.Current.Dispatcher.BeginInvoke(() => { readable.Text = read; }); } catch (WebException ex) { //MessageBox.Show(ex.Message, "Error", MessageBoxButton.OK); } }
b56d1e5b361c03fd7993d055ee3c7bfa8554ca0b
C#
synara/perceptron
/Perceptron/Perceptron/Perceptron.cs
3.421875
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace Perceptron { public class Perceptron { private static double[] inputs; private static double classe; public static int ativador(double saida) { if (saida >= 0) return 1; else return -1; } public static double perceptron(double[] entradas, double[] pesos) { double saida = 0.0; int i = 0; foreach (var p in pesos) { for (i = i; i < entradas.Length; i++) { saida += p * entradas[i]; i += 1; break; } } return ativador(saida); } public static double[] calcularPeso(double[] inputs, double[] pesos, double aprendizagem, double erro) { int j = 0; for (int i = 0; i < pesos.Length; i++) { for (j = j; j < inputs.Length; j++) { pesos[i] = pesos[i] + aprendizagem * erro * inputs[j]; j = j + 1; break; } } return pesos; } public static void treinar(List<double[]> entradas, double aprendizagem, double[] pesos, int bias = 1) { bool verificar = false; foreach (var item in entradas) { separarDados(item, bias); int controle = 1; double erro = 0.0d; while (true) { var p = perceptron(inputs, pesos); erro = classe - p; if (erro == 0) { Console.WriteLine($"({item[0] + "," + item[1] + ", " + item[2]}) correto na interação número {controle}."); controle += 1; break; } else { verificar = true; pesos = calcularPeso(inputs, pesos, aprendizagem, erro); Console.WriteLine($"({item[0] + "," + item[1] + ", " + item[2]}) incorreto na interação número {controle}."); controle += 1; } } } if (verificar) { treinar(entradas, aprendizagem, pesos); Console.WriteLine("Pesos finais: (" + pesos[0] + "," + pesos[1] + ", " + pesos[2] + ")"); } } private static void separarDados(double[] item, int bias) { inputs = new double[] { item[0], item[1], bias }; classe = Convert.ToInt32(item[2]); } } }
f3296761b44223bd95e5c1df57fcbb7b10f955d0
C#
b1712/UAVLandingSYS_Ship
/ShipImplementation/TestBusinessLayer/TestShipMotion.cs
2.796875
3
using System; using System.Text; using System.Collections.Generic; using System.Linq; using Microsoft.VisualStudio.TestTools.UnitTesting; using Assets.BusinessLayer; using System.Reflection; //using Assets.PresentationLayer; namespace TestBusinessLayer { [TestClass] public class TestShipMotion { /// <summary> /// This test method uses reflection to invoke the private method calculateRelativeSpeed() and /// check the private field relativeSpeed is within expected limits. /// /// Setup A_1 /// For SS6 in head on waves at max speed the relative speed should be between 20.0 and 24.1 m/s. /// /// </summary> [TestMethod] public void TestCalculateRelativeSpeed_Setup1() { ShipMotion target = new ShipMotion(SeaState.SeaState6, WaveDirection.Zero_Degrees, ShipSpeed.Full); //typeof(ShipMotion).GetMethod("calculateRelativeValues", // BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); float actual = (float)typeof(ShipMotion).GetField("relativeSpeed", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target); float expectedLow = 20.0f; float expectedHigh = 24.1f; Assert.IsTrue(actual >= expectedLow); Assert.IsTrue(actual <= expectedHigh); } /// <summary> /// This test method uses reflection to invoke the private method calculateRelativeSpeed() and /// check the private field relativeSpeed is within expected limits. /// Setup A_2 /// For SS3 in 45 degree waves at half speed the relative speed should be between 9.6 and 11.4 m/s. /// /// </summary> [TestMethod] public void TestCalculateRelativeSpeed_Setup2() { ShipMotion target = new ShipMotion(SeaState.SeaState3, WaveDirection.FortyFive_Degrees, ShipSpeed.Half); typeof(ShipMotion).GetMethod("calculateRelativeValues", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); float actual = (float)typeof(ShipMotion).GetField("relativeSpeed", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target); float expectedLow = 9.6f; float expectedHigh = 11.4f; Assert.IsTrue(actual >= expectedLow); Assert.IsTrue(actual <= expectedHigh); } /// <summary> /// This test method uses reflection to invoke the private method calculateRelativeSpeed() and /// check the private field relativeSpeed is within expected limits. /// Setup A_3 /// For SS0 in no waves at zero speed the relative speed should be between 0 m/s. /// /// </summary> [TestMethod] public void TestCalculateRelativeSpeed_Setup3() { ShipMotion target = new ShipMotion(SeaState.SeaState0, WaveDirection.Zero_Degrees, ShipSpeed.Stop); typeof(ShipMotion).GetMethod("calculateRelativeValues", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); float actual = (float)typeof(ShipMotion).GetField("relativeSpeed", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target); float expected = 0.0f; Assert.AreEqual(expected, actual); } /// <summary> /// This test method uses reflection to invoke the private method populateHeaveArray() and /// check the private collection heaveArray is within expected limits. /// Setup B_1 /// For SS6 in head on waves at max speed the maximum wave amplitude should be less than 6.0 m. /// /// </summary> [TestMethod] public void TestPopulateHeaveArray_S_S_6() { ShipMotion target = new ShipMotion(SeaState.SeaState6, WaveDirection.Zero_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> heaveArray = typeof(ShipMotion).GetField("heaveArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in heaveArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 6.0f; float expectedMin = -6.0f; Assert.IsTrue(expectedMax >= actualMax); Assert.IsTrue(expectedMin <= actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populateHeaveArray() and /// check the private collection heaveArray is within expected limits. /// Setup B_2 /// For SS3 in head on waves at max speed the maximum wave amplitude should be less than 1.25 m. /// /// </summary> [TestMethod] public void TestPopulateHeaveArray_S_S_3() { ShipMotion target = new ShipMotion(SeaState.SeaState3, WaveDirection.Zero_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> heaveArray = typeof(ShipMotion).GetField("heaveArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in heaveArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 1.25f; float expectedMin = -1.25f; Assert.IsTrue(expectedMax >= actualMax); Assert.IsTrue(expectedMin <= actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populateHeaveArray() and /// check the private collection heaveArray is within expected limits. /// Setup B_3 /// For SS0 in head on waves at max speed there are no waves so the amplitude is 0. /// /// </summary> [TestMethod] public void TestPopulateHeaveArray_S_S_0() { ShipMotion target = new ShipMotion(SeaState.SeaState0, WaveDirection.Zero_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> heaveArray = typeof(ShipMotion).GetField("heaveArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in heaveArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 0.0f; float expectedMin = 0.0f; Assert.AreEqual(expectedMax, actualMax); Assert.AreEqual(expectedMin, actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populatePitchArray() and /// check the private collection heaveArray is within expected limits. /// Setup C_1 /// For SS6 in head on waves at max speed, the maximum pitch angle is +/- 3.0 degrees. /// /// </summary> [TestMethod] public void TestPopulatePitchArray_S_S_6() { ShipMotion target = new ShipMotion(SeaState.SeaState6, WaveDirection.Zero_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; // There is a dependence on data generated from the populateHeaveArray so it must // be invoked first. typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); typeof(ShipMotion).GetMethod("populatePitchArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> pitchArray = typeof(ShipMotion).GetField("pitchArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in pitchArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 3.0f; float expectedMin = -3.0f; Assert.IsTrue(expectedMax >= actualMax); Assert.IsTrue(expectedMin <= actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populatePitchArray() and /// check the private collection heaveArray is within expected limits. /// Setup C_2 /// For SS3 in head on waves at max speed, the maximum pitch angle is +/- 0.53 degrees. /// /// </summary> [TestMethod] public void TestPopulatePitchArray_S_S_3() { ShipMotion target = new ShipMotion(SeaState.SeaState3, WaveDirection.Zero_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; // There is a dependence on data generated from the populateHeaveArray so it must // be invoked first. typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); typeof(ShipMotion).GetMethod("populatePitchArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> pitchArray = typeof(ShipMotion).GetField("pitchArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in pitchArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 0.53f; float expectedMin = -0.53f; Assert.IsTrue(expectedMax >= actualMax); Assert.IsTrue(expectedMin <= actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populatePitchArray() and /// check the private collection heaveArray is within expected limits. /// Setup C_3 /// For SS0 in to 90 degree waves at max speed, there are no waves so the pitch angle is 0. /// /// </summary> [TestMethod] public void TestPopulatePitchArray_S_S_0() { ShipMotion target = new ShipMotion(SeaState.SeaState0, WaveDirection.Ninety_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; typeof(ShipMotion).GetMethod("populatePitchArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> pitchArray = typeof(ShipMotion).GetField("pitchArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in pitchArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 0.0f; float expectedMin = 0.0f; Assert.AreEqual(expectedMax, actualMax); Assert.AreEqual(expectedMin, actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populateRollArray() and /// check the private collection heaveArray is within expected limits. /// Setup D_1 /// For SS6 in 90 degree waves at max speed, the maximum roll angle is +/- 16.0 degrees. /// /// </summary> [TestMethod] public void TestPopulateRollArray_S_S_6() { ShipMotion target = new ShipMotion(SeaState.SeaState6, WaveDirection.Ninety_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; // There is a dependence on data generated from the populateHeaveArray so it must // be invoked first. typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); typeof(ShipMotion).GetMethod("populateRollArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> rollArray = typeof(ShipMotion).GetField("rollArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in rollArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 16.0f; float expectedMin = -16.0f; Assert.IsTrue(expectedMax >= actualMax); Assert.IsTrue(expectedMin <= actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populateRollArray() and /// check the private collection heaveArray is within expected limits. /// Setup D_2 /// For SS3 in 90 degree waves at max speed, the maximum roll angle is +/- 8.0 degrees. /// /// </summary> [TestMethod] public void TestPopulateRollArray_S_S_3() { ShipMotion target = new ShipMotion(SeaState.SeaState3, WaveDirection.Ninety_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; // There is a dependence on data generated from the populateHeaveArray so it must // be invoked first. typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); typeof(ShipMotion).GetMethod("populateRollArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> rollArray = typeof(ShipMotion).GetField("rollArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in rollArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 8.0f; float expectedMin = -8.0f; Assert.IsTrue(expectedMax >= actualMax); Assert.IsTrue(expectedMin <= actualMin); } /// <summary> /// This test method uses reflection to invoke the private method populateRollArray() and /// check the private collection heaveArray is within expected limits. /// Setup D_3 /// For SS0 in 90 degree waves at max speed, there are no waves so the roll angle is 0. /// /// </summary> [TestMethod] public void TestPopulateRollArray_S_S_0() { ShipMotion target = new ShipMotion(SeaState.SeaState0, WaveDirection.Ninety_Degrees, ShipSpeed.Full); float actualMax = float.MinValue; float actualMin = float.MaxValue; // There is a dependence on data generated from the populateHeaveArray so it must // be invoked first. typeof(ShipMotion).GetMethod("populateHeaveArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); typeof(ShipMotion).GetMethod("populateRollArray", BindingFlags.NonPublic | BindingFlags.Instance).Invoke(target, null); IList<float> rollArray = typeof(ShipMotion).GetField("rollArray", BindingFlags.NonPublic | BindingFlags.Instance).GetValue(target) as IList<float>; foreach (float value in rollArray) { if (value > actualMax) { actualMax = value; } if (value < actualMin) { actualMin = value; } } // As the wave is sinusoidal the max and min values are an equal distance from 0 in the positive and // negative directions. float expectedMax = 0.0f; float expectedMin = 0.0f; Assert.AreEqual(expectedMax, actualMax); Assert.AreEqual(expectedMin, actualMin); } } }
d6fd055feeea766c09922c1b618d93f2575baf19
C#
frogsbreath-games/deckbuilder
/src/Deckbuilder.Core/Builders/Cards.cs
2.640625
3
using System.Collections.Generic; using Deckbuilder.Core.Enums; using Deckbuilder.Core.Models; using Deckbuilder.Core.Models.CardTypes; namespace Deckbuilder.Core.Builders { public static class Cards { public static SpellCard Spell( int id, string name, int price, CardAction? effect = null, IEnumerable<Ability>? abilities = null, FactionCode? faction = null, IEnumerable<KeywordCode>? keywords = null) { return new SpellCard( id, name, name.Replace(' ', '_').ToLower(), price, effect, abilities, faction: faction, keywords: keywords); } public static HeroCard Hero( int id, string name, FactionCode faction, CardAction? effect = null, IEnumerable<Ability>? abilities = null) { return new HeroCard( id, name, name.Replace(' ', '_').ToLower(), faction, effect, abilities); } public static MonsterCard Monster( int id, string name, int power, CardAction bounty, IEnumerable<KeywordCode>? keywords = null) { return new MonsterCard( id, name, name.Replace(' ', '_').ToLower(), power, bounty, keywords); } } }
09881c5b9cd4c4194dea22edc1f5df4ccb325d74
C#
umittal/MunimJi
/trunk/packages/src/envers/Query/Criteria/AuditRelatedId.cs
2.578125
3
using NHibernate.Envers.Query.Property; namespace NHibernate.Envers.Query.Criteria { public class AuditRelatedId { private readonly IPropertyNameGetter _propertyNameGetter; public AuditRelatedId(IPropertyNameGetter propertyNameGetter) { _propertyNameGetter = propertyNameGetter; } public IAuditCriterion Eq(object id) { return new RelatedAuditExpression(_propertyNameGetter, id, true); } public IAuditCriterion Ne(object id) { return new RelatedAuditExpression(_propertyNameGetter, id, false); } } }
400b246c76ae2e022fb096448b297168f557445d
C#
samuel-clemens/WSN
/Zad2/ViewModels/ViewModel.cs
2.65625
3
using System; using System.Collections.Generic; using System.Collections.ObjectModel; using System.ComponentModel; using System.Linq; using System.Text; using System.Threading.Tasks; using Zad2.Common; using Zad2.Models; namespace Zad2.ViewModels { /// <summary> /// Klasa ze wszystkimi zmiennymi do bindingowania w GUI /// </summary> public class ViewModel : ObservableObject { #region fields private SquareList _canvasList = new SquareList(); private List<SquareList> _imageList = SampleManager.Instance.Samples; private bool _isTaught = false; private bool _canReduceNoise = false; private bool _areChangesUnsaved = false; private string _filename = "[bez nazwy]"; private int _sampleId = 0; private int _sampleCount = 0; #endregion #region properties public SquareList CanvasSquareList { get { return _canvasList; } set { _canvasList = value; NotifyPropertyChanged("CanvasSquareList"); } } public SquareList ImageSquareList { get { if (_sampleCount > 0 && _sampleId - 1 >= 0 && _sampleId - 1 < _sampleCount) return _imageList[_sampleId-1]; return null; } set { _imageList[_sampleId-1] = value; } } public bool IsTaught { get { return _isTaught; } set { _isTaught = value; NotifyPropertyChanged("IsTaught"); } } public bool CanReduceNoise { get { return _canReduceNoise; } set { _canReduceNoise = value; NotifyPropertyChanged("CanReduceNoise"); } } public bool AreChangesUnsaved { get { return _areChangesUnsaved; } set { _areChangesUnsaved = value; NotifyPropertyChanged("AreChangesUnsaved"); } } public string FileName { get { return _filename; } set { _filename = value; NotifyPropertyChanged("FileName"); } } public int SampleId { get { return _sampleId; } set { _sampleId = value; NotifyPropertyChanged("SampleId"); NotifyPropertyChanged("ImageSquareList"); } } public int SampleCount { get { return _sampleCount; } set { _sampleCount = value; NotifyPropertyChanged("SampleCount"); } } public int ParentWidth { get { return Globals.ParentWidth; } } public int ParentHeight { get { return Globals.ParentHeight; } } #endregion public void LoadNewImageSquareList() { NotifyPropertyChanged("ImageSquareList"); SampleCount = _imageList.Count(); SampleId = 1; AreChangesUnsaved = false; } public void RemoveActualItemFromCollection() { if (SampleCount > 0) { _imageList.Remove(ImageSquareList); /* ta konstrukcja jest po to żeby jak się pokazuje np. "1/2" (że zdjęcie 1 z 2) to żeby po usunięciu jakiegoś się odpowiednie cyferki pokazywały nie jestem dumna z tej konstrukcji, ale zdobywam cenne doświadczenie i nastęnym razem zaprojektuję program jakoś tak by był ładniej niż to... */ if (SampleId == 1 && SampleCount == 1) SampleId = SampleCount = 0; else { SampleCount--; if (SampleId > 1) SampleId--; else NotifyPropertyChanged("ImageSquareList"); } } } public void LoadImageToCanvas() { for (int i = 0; i < ImageSquareList.Count(); ++i) { if (ImageSquareList[i].IsFilled) CanvasSquareList[i].IsFilled = true; else CanvasSquareList[i].IsFilled = false; } } } }
3328ce7b1240ed9b75c35eb481d9a522b13101e6
C#
AshbyGeek/Thermostat
/Thermostat/HardwareVirtualization/VirtualHardwareViewModel.cs
2.703125
3
using System; using System.Collections.Generic; using System.Text; namespace Thermostat.HardwareVirtualization { public class VirtualHardwareViewModel { public VirtualSystem System { get; } public VirtualClock Clock { get; } public VirtualHardwareViewModel(VirtualSystem system, VirtualClock clock) { System = system; Clock = clock; } public double OutdoorTemp { get => System.CurrentSensorValues.OutdoorTemp; set => System.CurrentSensorValues.OutdoorTemp = value; } public VirtualHardwareViewModel() { Clock = new VirtualClock(); System = new VirtualSystem(Clock); } } }
62dff066c047b8be200371d93d6829119bf94da6
C#
ypablo/StudentsDiary-C-sharp
/AddEditStudent.cs
2.953125
3
using System; using System.Collections.Generic; using System.ComponentModel; using System.Data; using System.Drawing; using System.IO; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Windows.Forms; namespace StudentsDiary { public partial class AddEditStudent : Form { private string _filePath = System.IO.Path.Combine(Environment.CurrentDirectory, "students3.txt"); private int _studentID; private Student _student; private FileHelper<List<Student>> _fileHelper = new FileHelper<List<Student>>(Program.FilePath); public AddEditStudent(int id = 0) { InitializeComponent(); _studentID = id; GetStudentData(); tbName.Select(); } private void GetStudentData() { if (_studentID != 0) { Text = "Edit student's info"; var students = _fileHelper.DeserializeFromFile(); _student = students.FirstOrDefault(x => x.Id == _studentID); if (_student == null) throw new Exception("Brak uzytkownika o podanym Id."); FillTextBoxes(); } } private void FillTextBoxes() { tbId.Text = _student.Id.ToString(); tbName.Text = _student.FirstName; tbSurename.Text = _student.SureName; tbMath.Text = _student.Math; tbPhysics.Text = _student.Physics; tbTechnology.Text = _student.Technology; tbEnglishLang.Text = _student.EnglishLang; tbFrenchLang.Text = _student.FrenchLang; rtbComments.Text = _student.Comments; } private void btnCancel_Click(object sender, EventArgs e) { Close(); } private void btnConfirm_Click(object sender, EventArgs e) { var students = _fileHelper.DeserializeFromFile(); if(_studentID != 0) { students.RemoveAll(x => x.Id == _studentID); } else { AssignIdToNewStudent(students); } var student = new Student { Id = _studentID, FirstName = tbName.Text, SureName = tbSurename.Text, Comments = rtbComments.Text, Math = tbMath.Text, Technology = tbTechnology.Text, EnglishLang = tbEnglishLang.Text, Physics = tbPhysics.Text, FrenchLang = tbFrenchLang.Text }; students.Add(student); _fileHelper.SerializeToFile(students); Close(); } private void AssignIdToNewStudent(List<Student> students) { var studentWithHighestId = students.OrderByDescending(x => x.Id).FirstOrDefault(); if (studentWithHighestId == null) { _studentID = 1; } else { _studentID = studentWithHighestId.Id + 1; } } } }
7671ef44735efcfa5c397be7e104f8260d9a55c0
C#
DerekLiang/microphone-volume-controller
/VolumeControl/Settings.cs
2.515625
3
using System.ComponentModel; using System.Configuration; using System.Windows.Media; namespace VolumeControl { public class Settings : ApplicationSettingsBase { [UserScopedSetting()] [DefaultSettingValue("")] public int DefaultVolume { get { if (this["DefaultVolume"] is string) { var returnVal = 50; int.TryParse((string) this["DefaultVolume"], out returnVal); return returnVal; } return ((int)this["DefaultVolume"]); } set { this["DefaultVolume"] = value; } } } }
586589dcc917d7150bc69a32808e8512255945cd
C#
wangjialei001/Storage
/WeiCloudStorageAPI/Model/RequestBackStatuEnum.cs
2.59375
3
using System; using System.Collections.Generic; using System.Linq; using System.Threading.Tasks; namespace WeiCloudStorageAPI.Model { public class Enumeration : IComparable { private readonly int _value; private readonly string _displayName; public int Value { get { return _value; } } public int CompareTo(object other) { return Value.CompareTo(((Enumeration)other).Value); } protected Enumeration() { } public string DisplayName { get { return _displayName; } } protected Enumeration(int value, string displayName) { _value = value; _displayName = displayName; } } public class RequestBackStatuEnum : Enumeration { private RequestBackStatuEnum(int value, string displayName) : base(value, displayName) { } /// <summary> /// 成功执行 /// </summary> public static readonly RequestBackStatuEnum success = new RequestBackStatuEnum(200, nameof(success).ToLowerInvariant()); /// <summary> /// 不存在指定对象 /// </summary> public static readonly RequestBackStatuEnum notexist = new RequestBackStatuEnum(2001, nameof(notexist).ToLowerInvariant()); /// <summary> /// 存在指定对象 /// </summary> public static readonly RequestBackStatuEnum exist = new RequestBackStatuEnum(2002, nameof(exist).ToLowerInvariant()); /// <summary> /// 存在指定条件的数据集 /// </summary> public static readonly RequestBackStatuEnum hasdata = new RequestBackStatuEnum(2003, nameof(hasdata).ToLowerInvariant()); /// <summary> /// 不存在指定条件的数据集 /// </summary> public static readonly RequestBackStatuEnum nodata = new RequestBackStatuEnum(2004, nameof(nodata).ToLowerInvariant()); /// <summary> /// 服务端错误 /// </summary> public static readonly RequestBackStatuEnum fail = new RequestBackStatuEnum(2005, nameof(fail).ToLowerInvariant()); /// <summary> /// 请求失败 /// </summary> public static readonly RequestBackStatuEnum badrequest = new RequestBackStatuEnum(2006, nameof(badrequest).ToLowerInvariant()); /// <summary> /// 未找到指定接口 /// </summary> public static readonly RequestBackStatuEnum notfound = new RequestBackStatuEnum(2007, nameof(notfound).ToLowerInvariant()); /// <summary> /// 网络连接失败 /// </summary> public static readonly RequestBackStatuEnum loselink = new RequestBackStatuEnum(2008, nameof(loselink).ToLowerInvariant()); /// <summary> /// 没有权限 /// </summary> public static readonly RequestBackStatuEnum unauthorized = new RequestBackStatuEnum(401, nameof(unauthorized).ToLowerInvariant()); public static IEnumerable<RequestBackStatuEnum> List() => new[] { success, badrequest, notfound, loselink }; } }
e98fbeb031381d80a485b016a518f0903741021c
C#
dukedhx/File-and-text-sharing-host
/ConsoleApplication1/WindowsFormsApplication1/SettingIO.cs
2.75
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.IO; using System.Reflection; namespace WindowsFormsApplication1 { static class SettingIO { static readonly public String pathname = "path", addrname = "addr", smtp ="smtp",pop3="pop3"; static readonly public String[] names = new String []{ pathname, addrname, smtp, pop3 }; static private String name; static public Boolean checkDB() { try { if (!File.Exists(Constants.dbfilename)) File.WriteAllBytes(Constants.dbfilename,WindowsFormsApplication1.Properties.Resources.Database1); } catch (Exception ex) { Console.WriteLine(ex.Message); return false; } return true; } static public String Name { get { if(String.IsNullOrEmpty(name))name=System.AppDomain.CurrentDomain.FriendlyName.Split(Constants.dot)[0] + ".ini"; return name;} } static public Dictionary<String,String> load() { try { if (File.Exists(Name)) { Dictionary<String, String> dict = new Dictionary<String, String>(); using(StreamReader sr = new StreamReader(Name)){ String line; var namelist = new List<String>(names); while (!String.IsNullOrEmpty((line = sr.ReadLine()))&& namelist.Count>0) { String[] parts=line.Split(Constants.equal); if (parts.Length > 1) { String vname = parts[0]; int id; if ((id=namelist.IndexOf(vname)) > -1) { if (dict.ContainsKey(vname)) dict[vname] = parts[1]; else dict.Add(vname,parts[1]); namelist.RemoveAt(id); } } } } return dict; } } catch (Exception ex) { Console.WriteLine(ex.Message); } return null; } static public void save(String name, String value) { try { Dictionary<String, String> dict = load(); if (dict.ContainsKey(name)) dict[name] = value; else dict.Add(name,value); save(dict); } catch (Exception ex) { Console.WriteLine(ex.Message); } } static public void save(Dictionary<String, String> dict) { try { if(Util.validateIE(dict)&&!String.IsNullOrEmpty(name)) File.WriteAllText(name,String.Join("\n",dict.Select(x=>x.Key+Constants.equal+x.Value).ToArray())); } catch (Exception ex) { Console.WriteLine(ex.Message); } } } }
59487a83f9306882aa2915047539f297a6b67212
C#
AndreyAkinshin/perfolizer
/src/Perfolizer/Perfolizer/Mathematics/Sequences/ArithmeticProgressionSequence.cs
2.796875
3
namespace Perfolizer.Mathematics.Sequences; public class ArithmeticProgressionSequence : ISequence { private readonly double start, step; public ArithmeticProgressionSequence(double start, double step) { this.start = start; this.step = step; } public double Value(int index) => start + index * step; }
cb4aac1192bbed6fd61ffc15080a294925ce38c6
C#
ADolodarenko/ExcelImageReader
/ExcelImageReader/Model/ImageLocators.cs
2.546875
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace ExcelImageReader.Model { public class ImageLocators { private String url; private String name; private String extension; public ImageLocators(String url, String name, String extension) { this.url = url; this.name = name; this.extension = extension; } public String GetUrl() { return url; } public String GetName() { return name; } public String GetExtension() { return extension; } } }
43e713e0568ca4762bb3bd432e4bc851647db1b2
C#
Ryocham-prog/AtCoderCSharp
/ABC/166/AtCoder/Abc/QuestionB.cs
3.28125
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace AtCoder.Abc { // https://atcoder.jp/contests/abc166/tasks/abc166_b class QuestionB { public static void Main(string[] args) { using (var sw = new System.IO.StreamWriter(Console.OpenStandardOutput())) { Console.SetOut(sw); // N:すぬけ君の数, K:お菓子の種類の入力 var inputArray = Console.ReadLine().Split(' ').Select(i => int.Parse(i)).ToArray(); if (inputArray.Length != 2) { Console.Error.WriteLine("入力値を確認してください。(入力形式:\"N K\")"); return; } var n = inputArray[0]; var k = inputArray[1]; var snackInfo = Enumerable.Range(1, k) .Select((x, index) => { // d: dnのお菓子を持っている人数 var d = int.Parse(Console.ReadLine()); // A:お菓子を持っている人 var aStr= Console.ReadLine(); var a = (d == 1) ? new int[1] { int.Parse(aStr) } : aStr.Split(' ').Select(i => int.Parse(i)); return new { d, a }; }).ToArray(); var trickCount = Enumerable.Range(1, n) .Select(check => { var treatCount = snackInfo.Where(x => x.a.Contains(check)).Count(); return treatCount; }) .Where(x => x == 0) .Count(); Console.WriteLine(trickCount.ToString()); Console.Out.Flush(); } } } }
a5339fee673c51ea38d09f597ddddaae3be8378a
C#
dotnet/dotnet-api-docs
/snippets/csharp/System.Windows.Forms/InputLanguage/FromCulture/source.cs
2.921875
3
using System; using System.Data; using System.ComponentModel; using System.Windows.Forms; public class Form1: Form { protected TextBox textBox1; // <Snippet1> public void SetNewCurrentLanguage() { // Gets the default, and current languages. InputLanguage myDefaultLanguage = InputLanguage.DefaultInputLanguage; InputLanguage myCurrentLanguage = InputLanguage.CurrentInputLanguage; textBox1.Text = "Current input language is: " + myCurrentLanguage.Culture.EnglishName + '\n'; textBox1.Text += "Default input language is: " + myDefaultLanguage.Culture.EnglishName + '\n'; //Print the new current input language. InputLanguage myCurrentLanguage2 = InputLanguage.CurrentInputLanguage; textBox1.Text += "New current input language is: " + myCurrentLanguage2.Culture.EnglishName; } // </Snippet1> }
6b72d7a8806686309b2bb742b8e448ba968fc6bf
C#
eeguia21/MicroMasterCSharpExercises
/Dynamic Programming/PlacingParentheses/PlacingParentheses/Program.cs
3.609375
4
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace PlacingParentheses { class Program { static void Main(string[] args) { int[] numbers = new int[6] {5, 8, 7, 4, 8, 9}; char[] ops = new char[5] {'-', '+', '*', '-', '+'}; int maxValue = 0; PlacingParenthesesDP objPP = new PlacingParenthesesDP(); maxValue = objPP.ComputeParenthesis(numbers, ops); Console.WriteLine(maxValue); Console.ReadLine(); } } public class PlacingParenthesesDP { public int ComputeParenthesis(int [] numbers, char [] ops) { int[,] Max = new int[numbers.Length, numbers.Length]; int[,] Min = new int[numbers.Length, numbers.Length]; int j = 0; int[] res = new int[2]; for (int i = 0; i < numbers.Length; i ++) { Min[i, i] = numbers[i]; Max[i, i] = numbers[i]; } for (int s = 0; s < numbers.Length - 1; s++) { for (int i = 0; i < numbers.Length - s - 1; i++) { j = i + s + 1; res = ComputeMinMax(i, j, Max, Min, ops); Min[i, j] = res[0]; Max[i, j] = res[1]; } } return Max[0, numbers.Length - 1]; } public int[] ComputeMinMax(int i, int j, int [,] Max, int [,] Min, char [] ops) { int min = 10000; int max = -10000; int a = 0; int b = 0; int c = 0; int d = 0; int[] result = new int[2]; for (int z = i; z < j; z++) { if (ops[z] == '+') { a = Max[i, z] + Max[z + 1, j]; b = Max[i, z] + Min[z + 1, j]; c = Min[i, z] + Max[z + 1, j]; d = Min[i, z] + Min[z + 1, j]; } else if (ops[z] == '-') { a = Max[i, z] - Max[z + 1, j]; b = Max[i, z] - Min[z + 1, j]; c = Min[i, z] - Max[z + 1, j]; d = Min[i, z] - Min[z + 1, j]; } else if (ops[z] == '*') { a = Max[i, z] * Max[z + 1, j]; b = Max[i, z] * Min[z + 1, j]; c = Min[i, z] * Max[z + 1, j]; d = Min[i, z] * Min[z + 1, j]; } min = Math.Min(min, Math.Min(a, (Math.Min(b, Math.Min(c, d))))); max = Math.Max(max, Math.Max(a, (Math.Max(b, Math.Max(c, d))))); } result[0] = min; result[1] = max; return result; } } }
1ddf0ac1228ee06bd1e25e06ba6fab6bb5e74835
C#
hwiewie/LeetCode
/202.cs
3.6875
4
using System; using System.Text; namespace HN { class happynumber { static bool ifhappynum(string str) { int[] looktable = new int[] { 0, 1, 4, 9, 16, 25, 36, 49 , 64, 81 }; int[] result = new int[50]; int count=0; while(true) { char[] tempnum = str.ToCharArray(); int numb=0; for(int i =0;i<str.Length;i++) { numb += looktable[Convert.ToInt32(tempnum[i])]; } result[count]=numb; for(int j=0;j<count;j++) { if(result[j]==numb) return false; } count++; if(numb==1) return true; str = numb.ToString(); } } public static void main(string[] args) { Console.WriteLine("請輸入一個數,程式會判斷是否為Happy number:"); string numstr = Console.ReadLine(); if(ifhappynum(numstr)) Console.WriteLine("此數為快樂數"); else Console.WriteLine("此數不是快樂數"); } } }
d47070a8d91369ea096a6d299d576e0d91694ff1
C#
EvansYe/bookingTest
/Server/BookingPlatform.Core/MyEnum/EnumPeriod.cs
3.03125
3
using System.ComponentModel; namespace BookingPlatform.Common.MyEnum { public enum EnumPeriod { Morning = 1, Nooning = 2, Afternoon = 3, Night = 4, Other = 0, } public static class EnumPeriod_Class { public static string EnumPeriod_GetExplainByEnum(EnumPeriod ep) { switch (ep) { case EnumPeriod.Morning: return "上午"; case EnumPeriod.Nooning: return "中午"; case EnumPeriod.Afternoon: return "下午"; case EnumPeriod.Night: return "夜间"; default: return "其他"; } } public static int EnumPeriod_GetExplainByTime(string t) { switch (t) { case "上午": return 1; case "中午": return 2; case "下午": return 3; case "夜间": return 4; default: return 0; } } public static string EnumPeriod_GetExplainByInt(int i) { switch (i) { case 1: return "上午"; case 2: return "中午"; case 3: return "下午"; case 4: return "夜间"; default: return "其他"; } } public static EnumPeriod EnumPeriod_GetEnum(string e) { switch (e) { case "上午": return EnumPeriod.Morning; case "中午": return EnumPeriod.Nooning; case "下午": return EnumPeriod.Afternoon; case "夜间": return EnumPeriod.Night; default: return EnumPeriod.Other; } } /// <summary> /// 科室检查时间 /// </summary> public static class EnumTimeInterval_Class { public static string EnumTimeInterval_GetEnum(string TimeInterval) { switch (TimeInterval) { case "0": return "0分钟"; case "1": return "15分钟"; case "2": return "30分钟"; case "3": return "45分钟"; default: return "60分钟"; } } public static int EnumTimeInterval_GetIntByDBInt(int timeInterval) { switch (timeInterval) { case 0: return 0; case 1: return 15; case 2: return 30; case 3: return 45; case 4: return 60; default: return 0; } } } public static class EnumCheckqueueType_Class { public static string EnumCheckqueueType_GetEnum(string TimeInterval) { switch (TimeInterval) { case "0": return "0分钟"; case "1": return "15分钟"; case "2": return "30分钟"; case "3": return "45分钟"; default: return "60分钟"; } } } public enum EnumExamInterval { [Description("不设置")] None = 1, [Description("启用检查科室间隔")] ExamClinicInterval = 2, [Description("启用检查队列间隔")] ExamQueueInterval = 3 } public static class EnumExamInterval_Class { public static EnumExamInterval EnumExamInterval_GetEnumByInt(int code) { switch (code) { case 1: return EnumExamInterval.None; case 2: return EnumExamInterval.ExamClinicInterval; case 3: return EnumExamInterval.ExamQueueInterval; default: return EnumExamInterval.None; } } public static string EnumExamInterval_GetStringByEnum(EnumExamInterval eg) { switch (eg) { case EnumExamInterval.None: return "不设置"; case EnumExamInterval.ExamClinicInterval: return "启用检查科室间隔"; case EnumExamInterval.ExamQueueInterval: return "启用检查队列间隔"; default: return "不设置"; } } public static int EnumExamInterval_GetIntByEnum(EnumExamInterval eg) { switch (eg) { case EnumExamInterval.None: return 1; case EnumExamInterval.ExamClinicInterval: return 2; case EnumExamInterval.ExamQueueInterval: return 3; default: return 1; } } } } }
d70fc768f6dbd97b1edfdcd3bc4a9c9865f78039
C#
dimitarpopov7/SoftUni
/SoftUni C# OOP Basic/1. Defining Classes Exercises/3. Opinion Poll/3. Opinion Poll/Program.cs
3.515625
4
namespace _3.Opinion_Poll { using System; using System.Collections.Generic; using System.Linq; public class Program { public static void Main() { int n = int.Parse(Console.ReadLine()); var listPeople = new List<Person>(); for (int i = 0; i < n; i++) { var currentPerson = Console.ReadLine().Split().ToList(); var person = new Person(currentPerson[0], int.Parse(currentPerson[1])); listPeople.Add(person); } foreach (var guy in listPeople.Where(x => x.Age > 30).OrderBy(x => x.Name)) { Console.WriteLine($"{guy.Name} - {guy.Age}"); } } } }
978504cb396016b7a59273ee29df0611c4551387
C#
MatheusRod0296/EClothing
/EClothing.Infra/SharedContext/RepositoryGeneric.cs
2.859375
3
using System.Collections.Generic; using System.Linq; using EClothing.Domain.SharedContext.Repository; using Microsoft.EntityFrameworkCore; namespace EClothing.Infra.SharedContext { public class RepositoryGeneric<TEntity, TKey> : IRepositoryGeneric<TEntity, TKey> where TEntity : class { private EClothingContext _context; public RepositoryGeneric(EClothingContext eClothing) { _context = eClothing; } public List<TEntity> Get() { return _context.Set<TEntity>().ToList(); } public TEntity GetById(TKey id) { return _context.Set<TEntity>().Find(id); } public void Insert(TEntity model) { _context.Set<TEntity>().Add(model); _context.SaveChanges(); } public void Update(TEntity model) { _context.Set<TEntity>().Attach(model); _context.Entry(model).State = EntityState.Modified; _context.SaveChanges(); } public void Delete(TEntity model) { _context.Set<TEntity>().Attach(model); _context.Entry(model).State = EntityState.Deleted; _context.SaveChanges(); } public void DeleteById(TKey id) { var model = GetById(id); Delete(model); } } }
4810464568e9d7a5f777e265c5faa1e06c9dfdd4
C#
gdanielch9/DesignPatterns
/Command/MathLib.cs
3.203125
3
using System; namespace Command { public class MathLib { protected int _value = 0; public int Value { get { return _value; } } public void Add(int argument) { _value += argument; } public void Substract(int argument) { _value -= argument; } public void Multiply(int argument) { _value *= argument; } public void Divide(int argument) { _value /= argument; } } }
851344d7a00904c3162094345fc2b398db81fc5b
C#
DylanJDCornish/VotingSystem
/constituencyvotingsystem/Report.cs
2.890625
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace ConstituencyVotingSystem { public class Report { public string RepType { get; set; } public List<ConstituencyDataMeasure> TotalVotesDataMeasure { get; set; } public Report(String repType) { this.RepType = repType; this.TotalVotesDataMeasure = new List<ConstituencyDataMeasure>(); } public override String ToString() { String votes = String.Format("\tVotes: "); foreach (var m in TotalVotesDataMeasure) { votes += String.Format("\n\t\t{0}", m.ToString()); } return String.Format("Constituency Report {0}:\n{1}", RepType, votes); } } }
75085befa628299602adfc984943fa8949d50e52
C#
gitprojectjockey/CompleteMvcCodeFirstProject
/ContosoWebUI/Controllers/HomeController.cs
2.65625
3
using ContosoWebUI.DAL; using ContosoWebUI.ViewModels; using System.Linq; using System.Web.Mvc; namespace ContosoWebUI.Controllers { public class HomeController : Controller { private SchoolContext db = new SchoolContext(); public ActionResult Index() { return View(); } public ActionResult About() { //IQueryable<EnrollmentDateGroup> data = from student in db.Students // group student by student.EnrollmentDate into dateGroup // select new EnrollmentDateGroup() // { // EnrollmentDate = dateGroup.Key, // StudentCount = dateGroup.Count() // }; //I used lamda expression instead IQueryable<EnrollmentDateGroup> data = db.Students .GroupBy(s => s.EnrollmentDate) .Select(s => new EnrollmentDateGroup() { EnrollmentDate = s.Key, StudentCount = s.Count() }); return View(data.ToList()); } public ActionResult Contact() { ViewBag.Message = "Your contact page."; return View(); } //Don't forget to dispose protected override void Dispose(bool disposing) { db.Dispose(); base.Dispose(disposing); } } }
590fa07d70bcc05e619a7ca7b3bfab2867586394
C#
joemorin73/EmpyrionServerManager
/SharedCode/Extensions.cs
3.046875
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace EmpyrionModApi.ExtensionMethods { public static class Extensions { public static bool AreTheSame( this Eleon.Modding.ItemStack[] lhs, Eleon.Modding.ItemStack[] rhs ) { if(lhs == null) { return (rhs == null); } else if (rhs == null) { return false; } if (lhs.Length != rhs.Length) { return false; } for(int i = 0; i < lhs.Length; ++i) { if((lhs[i].id != rhs[i].id) || (lhs[i].count != rhs[i].count)) { return false; } } return true; } public static System.Numerics.Vector3 ToVector3(this Eleon.Modding.PVector3 vector) { return new System.Numerics.Vector3(vector.x, vector.y, vector.z); } public static Eleon.Modding.PVector3 ToPVector3(this System.Numerics.Vector3 vector) { return new Eleon.Modding.PVector3(vector.X, vector.Y, vector.Z); } static public bool GreaterOrEqual(this System.Numerics.Vector3 lhs, System.Numerics.Vector3 rhs) { return ((lhs.X >= rhs.X) && (lhs.Y >= rhs.Y) && (lhs.Z >= rhs.Z)); } static public bool LessOrEqual(this System.Numerics.Vector3 lhs, System.Numerics.Vector3 rhs) { return ((lhs.X <= rhs.X) && (lhs.Y <= rhs.Y) && (lhs.Z <= rhs.Z)); } // Only format if args are actually passed in to prevent a string passed in from a config using {0} and crashing us. static public string SafeFormat(this string format, params object[] args) { return (args.Length > 0) ? string.Format(format, args) : format; } } }
94a59ee10bfebeb7d93c11d0ba4748063f99e3bf
C#
radtek/ZilLion.Core.TaskManager
/ZilLion.Core.TaskManager/ZilLion.Core.Unities/UnitiesMethods/Admin/AdminRun.cs
2.859375
3
using System; using System.Diagnostics; using System.Security.Principal; namespace ZilLion.Core.Unities.UnitiesMethods.Admin { public class AdminRun { /// <summary> /// 以管理员方式运行程序 /// </summary> public static void Run() { /** * 当前用户是管理员的时候,直接启动应用程序 * 如果不是管理员,则使用启动对象启动程序,以确保使用管理员身份运行 */ //获得当前登录的Windows用户标示 var identity = WindowsIdentity.GetCurrent(); var principal = new WindowsPrincipal(identity); //判断当前登录用户是否为管理员 //如果不是管理员,则以管理员方式运行 if (principal.IsInRole(WindowsBuiltInRole.Administrator)) return; //创建启动对象 var startInfo = new ProcessStartInfo { UseShellExecute = true, WorkingDirectory = Environment.CurrentDirectory, FileName = Process.GetCurrentProcess().MainModule.FileName, Verb = "runas" }; //设置启动动作,确保以管理员身份运行 Process.Start(startInfo); Environment.Exit(0); } } }
abe171164655156e4d1c1b5f6f2e4afc27426d3f
C#
kuite/CodeTask
/JetShop.RentalCars.Domain.Tests/CarRentsTests/CarRentPassTests.cs
2.5625
3
using System; using AutoFixture; using JetShop.RentalCars.Domain.CarRents; using JetShop.RentalCars.Domain.Cars; using Xunit; namespace JetShop.RentalCars.Domain.Tests.CarRentsTests { public class CarRentPassTests { [Theory] [InlineData(CarType.Compact, 2, 1.5, 1.4, 50, 3)] [InlineData(CarType.Minivan, 2, 1.5, 1.4, 50, 110.1)] [InlineData(CarType.Premium, 2, 1.5, 1.4, 50, 73.6)] [InlineData(CarType.Compact, 8, 1.5, 1.4, 40, 12)] [InlineData(CarType.Minivan, 8, 1.5, 1.4, 40, 104.4)] [InlineData(CarType.Premium, 8, 1.5, 1.4, 40, 70.4)] public void CalculateTotalPrice_WhenValidInput_ReturnsCorrectPrice( CarType carType, int durationDays, double baseDayRental, double kilometerPrice, int mileage, double expectedPrice) { // Arrange var fixture = new Fixture(); var rentStartOn = DateTime.Now; var rentEndOn = rentStartOn.AddDays(durationDays); var startMileage = 1; var endMileage = startMileage + mileage; var carRent = fixture.Build<CarRent>() .With(x => x.CarStartMileage, startMileage) .With(x => x.CarEndMileage, endMileage) .With(x => x.RentStartOn, rentStartOn) .With(x => x.RentEndOn, rentEndOn) .With(x => x.CarType, carType) .Create(); // Act var price = carRent.CalculateTotalPrice(baseDayRental, kilometerPrice); // Assert Assert.Equal(expectedPrice, price); } } }
ab8708f9b185c58b357ebac57ec9affc41b06fe4
C#
engeziellithon/SerieWeb-Api
/Udemy.Api/Dtos/UserForRegisterDto.cs
2.5625
3
using System.ComponentModel.DataAnnotations; namespace Udemy.Api.Dtos { public class UserForRegisterDto { [Required] [StringLength(30, MinimumLength = 2 , ErrorMessage = "The username need be between 2 and 30 characters")] public string Username { get; set; } [Required] [StringLength(8, MinimumLength = 4, ErrorMessage = "The password need be between 4 and 8 characters")] public string Password { get; set; } } }
6170183097c31c73f66998215063125945345090
C#
yzzzh/SCUT
/DB.cs
2.78125
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Data; using System.Data.SqlClient; namespace SCUT { class DB : IDisposable { private SqlConnection sqlConnection; public DB() { sqlConnection = new SqlConnection(@"server=DESKTOP-3UIQV75;database=SCUT;Trusted_Connection=SSPI;"); sqlConnection.Open(); } public DataTable getBySql(string sql) { SqlDataAdapter adapter = new SqlDataAdapter(new SqlCommand(sql, sqlConnection)); DataTable dataTable = new DataTable(); adapter.Fill(dataTable); return dataTable; } public void setBySql(string sql) { new SqlCommand(sql, sqlConnection).ExecuteNonQuery(); } public void Dispose() { sqlConnection.Close(); } } }
2536a83d2ad2c541ea2567e913e91f7efc773219
C#
ehotinger/leetcode
/easy/balanced-binary-tree.cs
3.75
4
// https://leetcode.com/problems/balanced-binary-tree/submissions/ /** * Definition for a binary tree node. * public class TreeNode { * public int val; * public TreeNode left; * public TreeNode right; * public TreeNode(int x) { val = x; } * } */ public class Solution { public bool IsBalanced(TreeNode root) { if(root == null) return true; var left = GetDepth(root.left); var right = GetDepth(root.right); if(Math.Abs(left-right) > 1) { return false; } return IsBalanced(root.left) && IsBalanced(root.right); } public int GetDepth(TreeNode root) { if(root == null) return 0; var left = GetDepth(root.left); var right = GetDepth(root.right); return Math.Max(left, right) + 1; } }
6b80ccca50cbf322af2299c368f76f4b96253ac7
C#
MorneJooste/ArkSavegameToolkitNet
/ArkSavegameToolkitNet/Data/ExtraDataFoliageHandler.cs
2.53125
3
using ArkSavegameToolkitNet.Exceptions; using ArkSavegameToolkitNet.Structs; using log4net; using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace ArkSavegameToolkitNet.Data { public class ExtraDataFoliageHandler : IExtraDataHandler { private static ILog _logger = LogManager.GetLogger(typeof(ExtraDataFoliageHandler)); public bool CanHandle(GameObject obj, long length) { return obj.ClassName.Token.Equals("InstancedFoliageActor"); } public IExtraData Read(GameObject obj, ArkArchive archive, long length) { var shouldBeZero = archive.GetInt(); if (shouldBeZero != 0) _logger.Warn($"Expected int after properties to be 0 but found {shouldBeZero} at {archive.Position - 4:X}"); var structMapCount = archive.GetInt(); IList<IDictionary<string, StructPropertyList>> structMapList = new List<IDictionary<string, StructPropertyList>>(structMapCount); try { for (int structMapIndex = 0; structMapIndex < structMapCount; structMapIndex++) { var structCount = archive.GetInt(); IDictionary<string, StructPropertyList> structMap = new Dictionary<string, StructPropertyList>(); for (int structIndex = 0; structIndex < structCount; structIndex++) { var structName = archive.GetString(); StructPropertyList properties = new StructPropertyList(archive, null); var shouldBeZero2 = archive.GetInt(); if (shouldBeZero2 != 0) _logger.Warn($"Expected int after properties to be 0 but found {shouldBeZero2} at {archive.Position - 4:X}"); structMap[structName] = properties; } structMapList.Add(structMap); } } catch (UnreadablePropertyException) { // Just stop reading and attach collected structs } ExtraDataFoliage extraDataFoliage = new ExtraDataFoliage(); extraDataFoliage.StructMapList = structMapList; return extraDataFoliage; } } }
e2a1162f448a0916cf4973bb82e0123ec0e875c4
C#
raihanthecooldude/Webtech
/PHP/Ticket Printer/Ticket Printer/TicketPrinter.cs
2.5625
3
using System; using System.Collections.Generic; using System.ComponentModel; using System.Data; using System.Drawing; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Windows.Forms; using System.IO; using iTextSharp.text; using iTextSharp.text.pdf; namespace Ticket_Printer { public partial class TicketPrinter : Form { public TicketPrinter() { InitializeComponent(); this.PreviewLabel.Visible = false; this.PreviewBtn.Visible = false; } private int quantity = 0; OpenFileDialog img = new OpenFileDialog(); private void BrowseClicked(object sender, EventArgs e) { img.Filter = "Choose Image(*.jpg;*.png;*.gif)|*.jpg;*.png;*.gif"; if (img.ShowDialog() == DialogResult.OK) { //ImagePictureBox.Image = Image.FromFile(img.FileName); ImagePictureBox.Image = System.Drawing.Image.FromFile(img.FileName); } } private void CreatePDFClicked(object sender, EventArgs e) { try { FileStream fs = new FileStream(@"C:\Users\Asus\Desktop\Ticket" + ".pdf", FileMode.Create, FileAccess.Write, FileShare.None); Document doc = new Document(PageSize.A4); PdfWriter writer = PdfWriter.GetInstance(doc, fs); doc.Open(); //BaseFont bft = BaseFont.CreateFont(BaseFont.TIMES_ROMAN, BaseFont.CP1252, false); //Font ft = new Font(bft, 12); Paragraph p = new Paragraph("\n\n"); //doc.Add(p); //string url = "C:/Users/Asus/Downloads/atlanta-skyline-by-colton-hd-wallpaper.jpg"; string url = img.FileName; iTextSharp.text.Image image = iTextSharp.text.Image.GetInstance(url); //doc.Add(image); quantity = Convert.ToInt32(QuantityTextBox.Text); for (int i = 0; i < quantity; i++) { doc.Add(image); doc.Add(p); } doc.Close(); MessageBox.Show("PDF has been generated.", "Done"); } catch { MessageBox.Show("There is an error.", "Error"); } } private void PreviewClicked(object sender, EventArgs e) { } } }
27c406a29283da8a4fd9bb02f839cedc21369690
C#
Zapperi/CodeSnippets
/Uneksimo/UIController.cs
2.65625
3
using System.Collections; using System.Collections.Generic; using UnityEngine; using UnityEngine.UI; /** * Author: Henri Leppänen * <summary> * Handles UI related events and delegates. * </summary> */ public class UIController : MonoBehaviour { public static UIController Instance; #region EVENTS public delegate void UIEventHandler(); public delegate void UIEventHandlerWorld(WorldManager.WorldID world); public delegate void SelectStickerEventHandler(int id); /// <summary> /// This event is raised when Drag has started on Dragpoint (Stickerbook). /// </summary> public event UIEventHandler StickerbookDragStarted; /// <summary> /// This event is raised when Settings panel is set to visible. /// </summary> public event UIEventHandler ShowSettings; /// <summary> /// This event is raised when Settings panel is set to hidden. /// </summary> public event UIEventHandler HideSettings; /// <summary> /// This event is raised when Settings visibility state is changed. /// </summary> public event UIEventHandler ToggleSettings; /// <summary> /// This event is raised when Sticker Book is set to visible. /// </summary> public event UIEventHandler ShowStickerBook; /// <summary> /// This event is raised when Sticker Book is set to hidden. /// </summary> public event UIEventHandler HideStickerBook; /// <summary> /// This event is raised when World Selection Buttons are set to visible. /// </summary> public event UIEventHandler ShowWorldButtons; /// <summary> /// This event is raised when World Selection Buttons are set to hidden. /// </summary> public event UIEventHandler HideWorldButtons; /// <summary> /// This event is raised when visibility state of World Selection Buttons is changed. /// </summary> public event UIEventHandler ToggleWorldButtons; /// <summary> /// This event is raised when World Selection Main Button has changed. World enum as parameter. /// </summary> public event UIEventHandlerWorld UpdateMainWorldButtonEvent; /// <summary> /// This event is raised when UI buttons are set to hidden. /// </summary> public event UIEventHandler HideUIButtons; /// <summary> /// This event is raised when UI buttons are set to visible. /// </summary> public event UIEventHandler ShowUIButtons; /// <summary> /// This event is raised when a Placed Sticker is selected. Instance ID (int) as parameter. /// </summary> public event SelectStickerEventHandler SelectSticker; #endregion /// <summary> /// Is UI currently hidden or not. /// </summary> public bool isUIHidden; private void Awake() { if(Instance == null) { Instance = this; } else { Destroy(this); } } private void Start() { if(GameController.Instance != null) { GameController.Instance.WorldActivated += ShowUI; WorldManager.Instance.WorldSelected += HideUI; GameController.Instance.GameControllerReady += HideUI; } } #region EVENT DELEGATES /// <summary> /// Raises SelectSticker event with given sticker instance ID. /// </summary> /// <param name="id">Instance ID of the Sticker.</param> public void OnSelectSticker(int id) { if(SelectSticker != null) { SelectSticker(id); } } /// <summary> /// Raises ShowSettings event. /// </summary> public void OnShowSettings() { if (ShowSettings != null) { ShowSettings(); } } /// <summary> /// Raises StickerbookDragStarted event. /// </summary> public void OnStickerbookDragStarted() { if (StickerbookDragStarted != null) { StickerbookDragStarted(); } } /// <summary> /// Raises HideSettings event. /// </summary> public void OnHideSettings() { if (HideSettings != null) { HideSettings(); } } /// <summary> /// Raises ShowStickerBook event. /// </summary> public void OnShowStickerBook() { if (ShowStickerBook != null) { ShowStickerBook(); } } /// <summary> /// Raises HideStickerBook event. /// </summary> public void OnHideStickerBook() { if (HideStickerBook != null) { HideStickerBook(); } } /// <summary> /// Raises ShowWorldButtons event. /// </summary> public void OnShowWorldButtons() { if (ShowWorldButtons != null) { ShowWorldButtons(); } } /// <summary> /// Raises HideWorldButtons event. /// </summary> public void OnHideWorldButtons() { if (HideWorldButtons != null) { HideWorldButtons(); } } /// <summary> /// Raises ToggleWorldButtons event. /// </summary> public void OnToggleWorldButtons() { if (ToggleWorldButtons != null) { ToggleWorldButtons(); } } /// <summary> /// Raises ToggleSettings event. /// </summary> public void OnToggleSettings() { if (ToggleSettings != null) { ToggleSettings(); } } #endregion /// <summary> /// Updates currently active world button with given world. /// </summary> /// <param name="world">New world that is active.</param> public void UpdateMainWorldButton(WorldManager.WorldID world) { if (UpdateMainWorldButtonEvent != null) { UpdateMainWorldButtonEvent(world); } } /// <summary> /// Hides World Selection Buttons and StickerBook Drag object. /// </summary> public void HideUI() { if(HideUIButtons != null) { isUIHidden = true; HideUIButtons(); } } /// <summary> /// Shows World Selection Buttons and StickerBook Drag object. /// </summary> public void ShowUI() { if (ShowUIButtons != null) { isUIHidden = false; ShowUIButtons(); } } }
d47fb4fdc344afc15c5e54f88fea9056c6326646
C#
Winvision/Sandboxable
/src/Hyak.Common/RetryHandler.cs
2.625
3
using Sandboxable.Hyak.Common.Properties; using Sandboxable.Hyak.Common.TransientFaultHandling; using System; using System.Globalization; using System.Net.Http; using System.Threading; using System.Threading.Tasks; namespace Sandboxable.Hyak.Common { /// <summary> /// Http retry handler. /// </summary> public class RetryHandler : DelegatingHandler { private readonly TimeSpan DefaultMinBackoff = new TimeSpan(0, 0, 1); private readonly TimeSpan DefaultMaxBackoff = new TimeSpan(0, 0, 10); private readonly TimeSpan DefaultBackoffDelta = new TimeSpan(0, 0, 10); /// <summary> /// Gets or sets retry policy. /// </summary> public RetryPolicy RetryPolicy { get; set; } /// <summary> /// Initializes a new instance of the <see cref="T:Hyak.Common.RetryHandler" /> class. Sets /// default retry policty base on Exponential Backoff. /// </summary> public RetryHandler() { var exponentialBackoff = new ExponentialBackoff(3, this.DefaultMinBackoff, this.DefaultMaxBackoff, this.DefaultBackoffDelta); this.RetryPolicy = new RetryPolicy<DefaultHttpErrorDetectionStrategy>(exponentialBackoff); } /// <summary> /// Initializes a new instance of the <see cref="T:Hyak.Common.RetryHandler" /> class. Sets /// the default retry policty base on Exponential Backoff. /// </summary> /// <param name="innerHandler">Inner http handler.</param> public RetryHandler(DelegatingHandler innerHandler) : base(innerHandler) { var exponentialBackoff = new ExponentialBackoff(3, this.DefaultMinBackoff, this.DefaultMaxBackoff, this.DefaultBackoffDelta); this.RetryPolicy = new RetryPolicy<DefaultHttpErrorDetectionStrategy>(exponentialBackoff); } /// <summary> /// Initializes a new instance of the <see cref="T:Hyak.Common.RetryHandler" /> class. /// </summary> /// <param name="retryPolicy">Retry policy to use.</param> /// <param name="innerHandler">Inner http handler.</param> public RetryHandler(RetryPolicy retryPolicy, DelegatingHandler innerHandler) : base(innerHandler) { if (retryPolicy == null) { throw new ArgumentNullException(nameof(retryPolicy)); } this.RetryPolicy = retryPolicy; } /// <summary> /// Sends an HTTP request to the inner handler to send to the server as an asynchronous /// operation. Retries request if needed based on Retry Policy. /// </summary> /// <param name="request">The HTTP request message to send to the server.</param> /// <param name="cancellationToken">A cancellation token to cancel operation.</param> /// <returns>Returns System.Threading.Tasks.Task&lt;TResult&gt;. The /// task object representing the asynchronous operation.</returns> protected override async Task<HttpResponseMessage> SendAsync(HttpRequestMessage request, CancellationToken cancellationToken) { this.RetryPolicy.Retrying += (sender, args) => { if (this.Retrying == null) { return; } this.Retrying(sender, args); }; HttpResponseMessage responseMessage = null; try { await this.RetryPolicy.ExecuteAsync(async () => { responseMessage = await base.SendAsync(request, cancellationToken).ConfigureAwait(false); if (!responseMessage.IsSuccessStatusCode) { throw new HttpRequestExceptionWithStatus(string.Format(CultureInfo.InvariantCulture, Resources.ResponseStatusCodeError, responseMessage.StatusCode, responseMessage.StatusCode)) { StatusCode = responseMessage.StatusCode }; } return responseMessage; }, cancellationToken).ConfigureAwait(false); return responseMessage; } catch { if (responseMessage != null) { return responseMessage; } throw; } } /// <summary> /// An instance of a callback delegate that will be invoked whenever a retry condition is encountered. /// </summary> public event EventHandler<RetryingEventArgs> Retrying; } }
f633d50730871f9b95deb3bf4d65d77e95340887
C#
SeregaFreeman/TeststackCalculator
/Calculator/CalculatorTest.cs
2.578125
3
using NUnit.Framework; using Calculator.utils; using Calculator.windows; using TestStack.White; using System.Threading; namespace Calculator { [TestFixture] public class CalculatorTest { private Application _app; [SetUp] public void StartApp() { LoggerUtil.InitLogger(); LoggerUtil.Log.Info("Test started"); ProcessesUtil.CloseAllProcessesByName(Settings.Default.processName); _app = App.GetInstance().GetApplication(); LoggerUtil.Log.Info("Precondition completed"); } [Test] public void UiTest() { MainWindow mainWindow = new MainWindow(_app); mainWindow.SelectMode("Standard"); mainWindow.EnterNumber(12); Thread.Sleep(1000); mainWindow.AddNumber(999); Thread.Sleep(1000); mainWindow.RememberResult(); mainWindow.EnterNumber(19); mainWindow.PressAdd(); Thread.Sleep(1000); mainWindow.GetNumberFromMemory(); mainWindow.PressEquals(); Assert.True("1030".Equals(mainWindow.GetResult())); } [TearDown] public void Cleanup() { _app.Kill(); LoggerUtil.Log.Info("Test finished\n"); } } }
e6492395c4b67e6192232533764e7eb52f2bc768
C#
M-Kersten/space-invaders
/innerspace-invaders/Assets/Scripts/Tools/CustomMaths.cs
3.390625
3
namespace Invaders.Tools { public static class CustomMaths { public static int CalculateFibonacci(int n) { if (n < 1) { UnityEngine.Debug.LogError($"number to get fibonacci for is {n}, this is lower than 1 and cannot be used in calculation"); return 0; } int fibNumber = n + 1; int[] fibonacci = new int[fibNumber + 1]; fibonacci[0] = 0; fibonacci[1] = 1; for (int i = 2; i <= fibNumber; i++) { fibonacci[i] = fibonacci[i - 2] + fibonacci[i - 1]; } return fibonacci[fibNumber]; } } }
2ff08b0ba61782d0fe897802851c64fc616cb345
C#
zsolti111/CFGlib
/CFGlib/CFGlib/CFGNode.cs
2.6875
3
using CFGlib; using dnlib.DotNet.Emit; using System; using System.Collections.Generic; using System.ComponentModel; using System.Xml.Serialization; namespace CFGlib { public class CFGNode { public int Id { get; set; } public Instruction Footer { get; set; } public Instruction Header { get; set; } public ControlFlowBlockType Type { get; set; } public uint ILOffset { get; set; } public enum NodeShape { Ellipse, Rectangle } public enum NodeBorder { Single, Double } public enum NodeColor { White, Green, Orange, Red, Indigo, Blue, None } [Browsable(false)] [ReadOnly(true)] public NodeColor Color { get; set; } [Category("Node details")] [DisplayName("Generated test code")] [Description("The generated source code if it is a leaf node and a test was generated (e.g., not a duplicate).")] [ReadOnly(true)] [XmlAttribute("gtc")] public string GenerateTestCode { get; set; } [Category("Node details")] [DisplayName("Node status")] [Description("Status of the node indicating whether there are remaining uncovered branches starting from this node.")] [ReadOnly(true)] [XmlAttribute("status")] public string Status { get; set; } [Category("Node details")] [DisplayName("Execution runs")] [Description("The list of executions that this node was involved in.")] [ReadOnly(true)] [XmlAttribute("runs")] public string Runs { get; set; } [Category("Node details")] [DisplayName("Method name")] [Description("Fully qualified name of the method that contains this node.")] [ReadOnly(true)] [XmlAttribute("method")] public string MethodName { get; set; } [Category("Node appearance")] [DisplayName("Shape (solver calls)")] [Description("Shape of the node determines if the node triggered a constraint solver call. If yes, the shape is an ellipse, otherwise it is a rectangle.")] [ReadOnly(true)] public NodeShape Shape { get; set; } [Category("Node details")] [DisplayName("Path condition")] [Description("Full form of the path condition that contains all constraints from the start.")] [ReadOnly(true)] [XmlAttribute("pc")] public string PathCondition { get; set; } [Category("Node details")] [DisplayName("Incremental path condition")] [Description("Incremental form of the path condition, compared to its parent node.")] [ReadOnly(true)] [XmlAttribute("ipc")] public string IncrementalPathCondition { get; set; } [Category("Node details")] [DisplayName("Source code mapping")] [Description("Aprroximation of the place in the source code.")] [ReadOnly(true)] [XmlAttribute("scm")] public string SourceCodeMappingString { get; set; } [Category("Node appearance")] [DisplayName("Border (source mapping)")] [Description("Border of the node determines if the node has exact source code location mapping. If yes, the border is doubled, otherwise the border is single.")] [ReadOnly(true)] public NodeBorder Border { get; set; } private Stack<NodeColor> originalColors = new Stack<NodeColor>(); public bool IsSelected { get; set; } public void Deselect () { IsSelected = false; RevertToOriginalColor(); } public void RevertToOriginalColor () { NodeColor o; if (originalColors.Count == 1) o = originalColors.Peek(); else o = originalColors.Pop(); if (o != Color) { Color = o; } } public bool IsCollapsed { get; set; } public HashSet<CFGNode> CollapsedSubtreeNodes { get; private set; } public HashSet<CFGEdge> CollapsedSubtreeEdges { get; private set; } public CFGNode ( int id, Instruction footer, Instruction header, ControlFlowBlockType type, uint iLOffset, bool solverCall ) { Id = id; Footer = footer; Header = header; Type = type; ILOffset = iLOffset; Shape = ( solverCall ) ? NodeShape.Ellipse : NodeShape.Rectangle; } public CFGNode ( int id, bool solverCall ) { Id = id; Shape = ( solverCall ) ? NodeShape.Ellipse : NodeShape.Rectangle; } public override string ToString () { return Id.ToString(); } public static CFGNode Factory ( string id ) { return new CFGNode(int.Parse(id), false); } public void Select () { IsSelected = true; NodeColor o = originalColors.Peek(); //else o = originalColors.Pop(); if (o != NodeColor.Blue) { originalColors.Push(Color); Color = NodeColor.Blue; } } public void Collapse () { NodeColor o; if (originalColors.Count == 1) o = originalColors.Peek(); else o = originalColors.Pop(); if (o != NodeColor.Indigo) { originalColors.Push(Color); Color = NodeColor.Indigo; } } public void Expand () { if (IsSelected) { originalColors.Pop(); } RevertToOriginalColor(); } } }
a4b2a05f6cc548bd8333269a591d3d1435165a30
C#
surfsky/AppPlat4
/Utils/App.UtilsTests/Serialization/JsonHelperTests.cs
2.546875
3
using Microsoft.VisualStudio.TestTools.UnitTesting; using App.Utils; using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace App.Utils.Tests { [TestClass()] public class JsonHelperTests { [TestMethod()] public void ParseJsonTest() { Person p = new Person("Kevin"); var txt = p.ToJson(); var o = txt.ParseJson<Person>(); Assert.AreEqual(p.Name, o.Name); txt = "blabla"; o = txt.ParseJson<Person>(true, null); Assert.AreEqual(o, null); } } }
051ba45aab970ebcf7b05b9ac50ac646ff799820
C#
cjlpowers/Inaugura
/Inaugura.RealLeads/LevelCollection.cs
3.328125
3
using System; using System.Collections.Generic; using System.Text; using System.Xml; namespace Inaugura.RealLeads { /// <summary> /// A collection of levels /// </summary> public class LevelCollection : System.Collections.CollectionBase, Inaugura.Xml.IXmlable { #region Variables #endregion #region Accessors /// <summary> /// Returns the level at the specified zero based index /// </summary> /// <param name="index">The zero based index into the collection</param> /// <returns>The level at the specified index</returns> public Level this[int index] { get { return this.List[index] as Level; } } /// <summary> /// Returns the level with a specific ID /// </summary> /// <param name="id">The ID of the level</param> /// <returns>The level with the specified ID</returns> [Obsolete()] public Level this[string id] { get { Guid guid = new Guid(id); return this[guid]; } } /// <summary> /// Returns the level with a specific ID /// </summary> /// <param name="id">The ID of the level</param> /// <returns>The level with the specified ID</returns> public Level this[Guid id] { get { foreach (Level level in this) { if (level.ID == id) return level; } return null; } } #endregion #region IXmlable Members /// <summary> /// The xml representation of the the instance /// </summary> public XmlNode Xml { get { XmlNode node = Inaugura.Xml.Helper.NewNodeDocument("Levels"); this.PopulateNode(node); return node; } } #endregion #region Method /// <summary> /// Constructor /// </summary> /// <param name="node">The xml node which represents the instance</param> public LevelCollection(XmlNode node) { this.PopulateInstance(node); } /// <summary> /// Constructor /// </summary> public LevelCollection() { } /// <summary> /// Adds a level to the collection /// </summary> /// <param name="level">The level to add</param> public void Add(Level level) { this.List.Add(level); } /// <summary> /// Removes a level from the collection /// </summary> /// <param name="level">The level to remove</param> public void Remove(Level level) { this.List.Remove(level); } /// <summary> /// Determins wheather the collection contains a level /// </summary> /// <param name="level">The level</param> /// <returns>True if the collection contains the level, false otherwise</returns> public bool Contains(Level level) { return this.List.Contains(level); } /// <summary> /// Gets a level which contains a specific room /// </summary> /// <param name="roomID">The id of the room</param> /// <returns>The level containing the room, otherwise null</returns> public Level GetLevelByRoom(Guid roomID) { foreach (Level level in this) { if (level.Rooms[roomID] != null) return level; } return null; } /// <summary> /// Moves a level up in the list /// </summary> /// <param name="levelID">The ID of the level</param> public void MoveUp(string levelID) { Level r = this[levelID]; if (r != null) this.MoveUp(r); } /// <summary> /// Moves a level up in the list /// </summary> /// <param name="level">The level to move</param> public void MoveUp(Level level) { if (level == null) return; lock (this.List) { if (this.List.Contains(level)) { int index = this.List.IndexOf(level); if (index != 0) { index--; this.List.Remove(level); this.List.Insert(index, level); } } } } /// <summary> /// Moves a level down in the list /// </summary> /// <param name="levelID">The level ID</param> public void MoveDown(string levelID) { Level r = this[levelID]; if (r != null) this.MoveDown(r); } /// <summary> /// Moves a room down in the list /// </summary> /// <param name="level">The level to move</param> public void MoveDown(Level level) { if (level == null) return; lock (this.List) { if (this.List.Contains(level)) { int index = this.List.IndexOf(level); if (index != this.List.Count - 1) { index++; this.List.Remove(level); this.List.Insert(index, level); } } } } /// <summary> /// Determins the index of a specific level in the list /// </summary> /// <param name="level">The level</param> /// <returns>The index</returns> public int IndexOf(Level level) { lock (this.List) { return this.List.IndexOf(level); } } /// <summary> /// Populates a xml node with the objects data /// </summary> /// <param name="node">The node to populate</param> public virtual void PopulateNode(XmlNode node) { foreach (Level level in this) { XmlNode levelNode = node.OwnerDocument.CreateElement("Level"); level.PopulateNode(levelNode); node.AppendChild(levelNode); } } /// <summary> /// Populates the instance with the specifed xml data /// </summary> /// <param name="node">The xml node</param> public virtual void PopulateInstance(XmlNode node) { XmlNodeList nodes = node.SelectNodes("Level"); foreach (XmlNode levelNode in nodes) { Level level = new Level(levelNode); this.Add(level); } } #endregion } }
c11080d342757e95ea7979e5c6e0d3f2022ca0e8
C#
MargaritaKolosok/CSharp
/Starter/Lesson_9/Task_1-1/Task_1-1/Program.cs
3.875
4
using System; namespace Task_1_1 { class Program { // Create First Array with set by User arrLength, and random values static int[] CreateArray(int[] array, int arrLength) { for (int i=0; i<array.Length; i++) { array[i] = arrLength * (i+1) + 2*i; } return array; } // Check max, min, avarage, Sum of elements of the array static void ArrayAnalysis(int[] array, out int max, out int min, out int avarage, out int SumEl) { max = 0; min = array[1]; avarage = 0; int Sum = 0; for (int i=0; i<array.Length; i++) { if (array[i] > max) { max = array[i]; } if (array[i] < min) { min = array[i]; } Sum += array[i]; } SumEl = Sum; avarage = Sum / array.Length; } // Check number of even numbers in the array static int EvenNum(int[] array, out int evenNum) { evenNum = 0; for (int i=0; i<array.Length; i++) { if (IsEven(array[i])) { evenNum++; } } return evenNum; } // Check is array elements value Even static bool IsEven(int Num) { bool result = false; if (Num % 2 != 0) { result = true; } else { result = false; } return result; } // Create new Even array with length equal to its even elements. Save even elements of the array to even array static void CreateEvenArray(int[] array, ref int evenNum, out int[] myEvenArray) { int[] evenArray = new int[evenNum]; int j = 0; for (int i=0; i<array.Length; i++) { if (IsEven(array[i])) { evenArray[j] = array[i]; j++; } } myEvenArray = evenArray; } static void Main(string[] args) { Console.WriteLine("Enter number of array elements:"); // User enters Number of Array elements int arrLength = Convert.ToInt32(Console.ReadLine()); // Create myArray int[] myArray = new int [arrLength]; myArray = CreateArray(myArray, arrLength); // Check min, max, avarage, Sum numbers in the array ArrayAnalysis(myArray, out int maxValue, out int minValue, out int avarageValue, out int SumValue); // Show Array that was Created for (int i=0; i<myArray.Length; i++) { Console.WriteLine("Array element {0}", myArray[i]); } // Array Analysis result Console.WriteLine("Array MAX element {0}, Array MIN element {1}, Array AVARAGE {2}, Sum of elements {3}", maxValue, minValue, avarageValue, SumValue); Console.WriteLine("Even numbers in array {0}", EvenNum(myArray, out int evenNumbers)); CreateEvenArray(myArray, ref evenNumbers, out int[] myEvenArray); for (int i = 0; i < myEvenArray.Length; i++) { Console.WriteLine("Array EVEN element {0}", myEvenArray[i]); } Console.ReadKey(); } } }
bf941c801c3e4ce9b53345c993ee2023365961fe
C#
GrupoAura/Developer
/Inventario/Vistas/Clientes/listClientes.cs
2.515625
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Windows.Forms; using System.Data.SqlClient; using System.Data; namespace inventory.Vistas.Clientes { class listClientes : Panel { public SqlConnection conection; public Panel list() { InitializeComponent(); try { System.Data.SqlClient.SqlCommand cmd = new System.Data.SqlClient.SqlCommand("SELECT * FROM usuarios", conection); conection.Open(); System.Data.SqlClient.SqlDataReader reader = cmd.ExecuteReader(); if (reader.HasRows == true) { while (reader.Read()) { MessageBox.Show(String.Format("{0}", reader["usuario"]) + " " + String.Format("{0}", reader["usuario"])); } reader.Close(); } else { //RETORNO = false; //ERROR = "El Usuario o Contraseña son incorrectas."; } } catch (Exception err) { MessageBox.Show("Hola - " + err.Message); //ERROR = "La Conexion con el servidor fallo.\n" /* + "Posibles Causas:\n " + "\t1. Su computadora no tiene conexion a la red.\n" + "\t2. El servidor no esta accesible.\n" + "Por favor intente mas tarde. Si el problema persiste pongase en contacto con el administrador del sistema.";*/ //RETORNO = false; } finally { //conection.Close(); } return this; } private void InitializeComponent() { this.SuspendLayout(); this.ResumeLayout(false); } } }
ef7ccd93f309a3140a76c82ea4c1ab03345a01a6
C#
jknopp/RedisCacheLib
/CacheStack/CacheTrigger.cs
2.515625
3
namespace CacheStack { public interface ICacheTrigger { /// <summary> /// Key to store cache keys for items watching updates to any item /// </summary> string CacheKeyForAnyItem { get; } /// <summary> /// Key to store cache keys for an individual item /// </summary> string CacheKeyForIndividualItem { get; } } public class CacheTrigger : ICacheTrigger { public string CacheKeyForAnyItem { get; set; } public string CacheKeyForIndividualItem { get; set; } } }
85ddfbe8d9ac85a9a320f2477b0109dad7c3b5e2
C#
michelgrootjans/qwars
/src/QWars.NHibernate.Tests/GangCrudTests.cs
2.71875
3
using System.Linq; using NUnit.Framework; using QWars.NHibernate.Entities; namespace QWars.NHibernate.Tests { [TestFixture] public class GangCrudTests : DataAccessTest { private object gangId; private object bossId; private const string gangName = "Los Techies"; protected override void PrepareData() { var boss = new Player("boss"); var gang = boss.CreateGang(gangName, "yeah"); session.Save(boss); gangId = session.GetIdentifier(gang); bossId = session.GetIdentifier(boss); } [Test] public void should_be_able_to_get_gang_from_db() { var gang = session.Get<Gang>(gangId); Assert.AreEqual(gangName, gang.Name); } [Test] public void gang_boss_should_be_player() { var player = session.Get<Player>(bossId); var gang = session.Get<Gang>(gangId); Assert.AreSame(player, gang.Boss); } [Test] public void added_member_should_be_persisted() { var gang = session.Get<Gang>(gangId); var member = new Player("member"); session.Save(member); member.Join(gang); FlushAndClear(); gang = session.Get<Gang>(gangId); Assert.AreEqual(1, gang.Members.Count()); } [Test] public void added_task_should_be_persisted() { var gang = session.Get<Gang>(gangId); gang.CreateTask("do it", 1, 2, 3); FlushAndClear(); gang = session.Get<Gang>(gangId); Assert.AreEqual(1, gang.Tasks.Count()); } } }
1849e96d2ec12e8740cfeab53407d051723856e1
C#
KashaTeplaya/CalkulVADANDR
/CALKULATOR/CALKULATOR.tests/TwoArgumentsOperations/DivTest.cs
2.671875
3
using System; using CALKULATOR.TwoArgumentsOperations; using NUnit.Framework; namespace CALKULATOR.tests.TwoArgumentsOperations { [TestFixture] public class DivTest { [Test] public void CalculateTest() { ITwoArgumentsCalculator calculator = new Div(); double result = calculator.Calculate(10, 5); Assert.AreEqual(2, result); } [Test] public void ErrorTest() { var calculator = new Div(); Assert.Throws<Exception>(() => calculator.Calculate(-5, 0)); } } }
2e64558a180c2f5c5e25ef08428dfc841849a4d3
C#
CodeMasterZeroOne/Event-Driven-Programming
/Exercise 02/Submision414/SimpleGenericLoginSystem/SimpleGenericLoginSystem/RegisterForm.cs
2.625
3
using System; using System.Collections.Generic; using System.ComponentModel; using System.Data; using System.Drawing; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Windows.Forms; namespace SimpleGenericLoginSystem { public partial class RegisterForm : Form { private Form callingForm; private HelpForm helpForm; private User user; /// <summary> /// Public method for initialization of the values. /// </summary> /// <param name="callingForm"></param> public RegisterForm(Form callingForm) { this.callingForm = callingForm; this.user = new User(); InitializeComponent(); } private void RegisterForm_Load(object sender, EventArgs e) { comboBoxInputRole.SelectedIndex = 0; } private void buttonCancelRegistration_Click(object sender, EventArgs e) { this.Close(); callingForm.Show(); } private void buttonRegisterUser_Click(object sender, EventArgs e) { if (String.IsNullOrEmpty(textBoxInputFirstName.Text) || String.IsNullOrEmpty(textBoxInputLastName.Text) || String.IsNullOrEmpty(textBoxInputUserID.Text) || String.IsNullOrEmpty(textBoxInputPassword.Text) || String.IsNullOrEmpty(textBoxInputEmail.Text)) { string message = "Fields required are:\nFirst Name:\nLast Name:\nUser ID:\nPassword:\nEmail:\n"; string caption = "New User"; MessageBoxButtons buttons = MessageBoxButtons.OK; MessageBox.Show(message, caption, buttons, MessageBoxIcon.Exclamation); } else { string message = "New user registered successfully."; string caption = "New User"; MessageBoxButtons buttons = MessageBoxButtons.OK; MessageBox.Show(message, caption, buttons, MessageBoxIcon.Asterisk); callingForm.Show(); } } private void exitToolStripMenuItem1_Click(object sender, EventArgs e) { Application.Exit(); } private void exitToolStripMenuItem_Click(object sender, EventArgs e) { helpForm = new HelpForm(); helpForm.Show(); } private void comboBoxInputRole_SelectedIndexChanged(object sender, EventArgs e) { user.setUsersRole(comboBoxInputRole.SelectedIndex); labelUserPrivilages.Text = "User privilages: " + "\nView Account Information: " + user.ViewAccountInformation + " View Account Balances: " + user.ViewAccountBalances + "\nManage Account: " + user.ManageAccount + " Authorise Account Payments: " + user.AuthoriseAccountPayments + "\nInput Account Payments: " + user.InputAccountPayments + " View Audit Records: " + user.ViewAuditRecords + "\nGenerate Audit Records: " + user.GenerateAuditRecords + " Administration Report Privileges: " + user.AdministrationReportPrivileges + "\nAdministration Full Access: " + user.AdministrationFullAccess; } } }
455530d0559df906ca409cb635f79ef06c52dade
C#
atanas-georgiev/TelerikAcademy
/16.ASP.NET-Web-Forms/Homeworks/TestExam/TestExam.WebForms/Admin/Categories.aspx.cs
2.609375
3
using System; using System.Data.Entity.Infrastructure; using System.Linq; using TestExam.Data.Models; using TestExam.Data.Repositories; namespace TestExam.WebForms.Admin { public partial class Categories : System.Web.UI.Page { GenericRepository<Category> categories = new GenericRepository<Category>(); protected void Page_Load(object sender, EventArgs e) { } public IQueryable<Category> GridViewCategories_SelectItem() { return categories.All().OrderBy(c => c.Id); ; } public void GridViewCategories_UpdateItem(int id) { var category = categories.All().FirstOrDefault(c => c.Id == id); if (category != null) { TryUpdateModel(category); if (ModelState.IsValid) { try { categories.SaveChanges(); } catch (DbUpdateException) { CustomValidator.IsValid = false; CustomValidator.ErrorMessage = $"Category {category.Name} already exists"; } } } this.GridViewCategories.DataBind(); } public void GridViewCategories_DeleteItem(int id) { try { categories.Delete(id); categories.SaveChanges(); } catch (Exception) { CustomValidator.IsValid = false; CustomValidator.ErrorMessage = "Error during update"; } this.GridViewCategories.DataBind(); } protected void ButtonInsertCategory_OnClick(object sender, EventArgs e) { var newCategory = new Category() { Name = this.TextBoxNewCategory.Text }; try { categories.Add(newCategory); categories.SaveChanges(); } catch (Exception) { CustomValidator.IsValid = false; CustomValidator.ErrorMessage = $"Category {newCategory.Name} already exists"; } this.GridViewCategories.DataBind(); } protected void ButtonCancel_OnClick(object sender, EventArgs e) { this.TextBoxNewCategory.Text = string.Empty; } } }
43fa93bde227e1fee59318456011945042dd9904
C#
mygithubnelsonr/AdvancedProgramming
/ExtensionMethods/Program.cs
3
3
using System; namespace ExtensionMethods { class Program { static void Main(string[] args) { // string von https://de.lipsum.com/ string post = "Lorem ipsum dolor sit amet, consectetur adipiscing elit Etiam lacus."; var shortedPost = post.Shorten(0); Console.WriteLine(shortedPost + " ..."); #if DEBUG Console.WriteLine("press any key to finish"); Console.ReadKey(); #endif } } }
be0b87ff8861ca271449490b5a83bb2724edd997
C#
shendongnian/download4
/code3/390704-8578888-19287601-1.cs
3.265625
3
private void Form1_Load(object sender, EventArgs e) { SetupClickEvents(this); } /// <summary> /// This will loop through each control within the container and add a click handler to it /// </summary> /// <param name="container">The container whose children to handle clicks for</param> private void SetupClickEvents(Control container) { foreach(Control control in container.Controls) { control.Click += (s, e) => { HandleClicks(s, e); }; } } private void HandleClicks(object sender, EventArgs e) { Control control = (Control)sender; MessageBox.Show(string.Format("{0} was clicked!", control.Name)); }
b669fa72ffbd0110a49c6b44b6bbaeef74df3859
C#
thesilentpsycho/PongUnity3D
/Assets/Scenes/GameManager.cs
2.640625
3
using System; using System.Collections; using System.Collections.Generic; using UnityEngine; using UnityEngine.UI; public class GameManager : MonoBehaviour { public Ball ball; public Paddle leftPaddle; public Paddle rightPaddle; public Text victoryMessage; public int leftPlayerLife = 0; public int rightPlayerLife = 0; public int scoreToWin = 3; public Text LeftHealthText; public Text RightHealthText; public static bool restartGame; public static Vector2 bottomLeft; public static Vector2 topRight; // Use this for initialization void Start () { bottomLeft = Camera.main.ScreenToWorldPoint(new Vector2(0, 0)); topRight = Camera.main.ScreenToWorldPoint(new Vector2(Screen.width, Screen.height)); } void Update() { } public void UpdateScore(string player) { if (player.Equals("left")) { Debug.Log("update score called"); leftPlayerLife += 1; LeftHealthText.text = "Points: " + leftPlayerLife; } else if (player.Equals("right")) { Debug.Log("update score called"); rightPlayerLife += 1; RightHealthText.text = "Points: " + rightPlayerLife; } CheckIfGameIsWon(); } private void CheckIfGameIsWon() { if (leftPlayerLife >= scoreToWin) HandleEndGame("left"); else if (rightPlayerLife >= scoreToWin) HandleEndGame("right"); } public void HandleEndGame(string playerWhoWon) { DisplayEndMessage(playerWhoWon); } public void DisplayEndMessage(string playerWhoWon) { string victoryMessage = "Player "; if(playerWhoWon == "left") { victoryMessage += "1 Won !!"; } else { victoryMessage += "2 Won !!"; } this.victoryMessage.text = victoryMessage; Time.timeScale = 0; } }
b77c9993cad976a83c416e2ea256f507126cfad1
C#
Marcossdavi00/LojaVirtual
/ApiLojaVirtual/Service/Service/ServiceProducts.cs
2.578125
3
using Domain.Entity; using Domain.Interfaces.Repository; using Domain.Interfaces.Service; using System.Collections.Generic; using System.Threading.Tasks; namespace Service.Service { public class ServiceProducts: IServiceProduct { private readonly IRepositoryProducts _repository; public ServiceProducts(IRepositoryProducts repository) { _repository = repository; } public async Task<bool> Delete(int Id) { return await _repository.Delete(Id); } public async Task<IList<ProductEntity>> FindAll() { return await _repository.FindAll(); } public async Task<ProductEntity> FindById(int id) { return await _repository.FindById(id); } public async Task<ProductEntity> FindName(string name) { return await _repository.FindName(name); } public async Task<ProductEntity> Insert(ProductEntity product) { return await _repository.Insert(product); } public async Task<ProductEntity> Update(ProductEntity product) { return await _repository.Update(product); } } }
4ed373b8c05838d727a8f12653eded01d227d884
C#
young-hwang/OOP_with_.Net
/CodeAnalysis2/Form1.cs
2.875
3
using System; using System.Collections.Generic; using System.ComponentModel; using System.Data; using System.Drawing; using System.Linq; using System.Text; using System.Threading.Tasks; using System.Windows.Forms; namespace CodeAnalysis2 { public partial class Form1 : Form { private Classes m_classes = new Classes(); public Form1() { InitializeComponent(); } private void DisplayClasses() { AClass[] classes = new AClass[m_classes.Count]; for (int i = 0; i < m_classes.Count; i++) { //Using the indexer classes[i] = m_classes[i]; } this.listOfFiles.DataSource = classes; linesOfCode.Text = "Lines of code: " + m_classes.LinesOfCode.ToString(); } private void browse_Click(object sender, EventArgs e) { try { openSourceFile.Filter = "Visual C# files (*.cs)|*.cs"; System.Windows.Forms.DialogResult result; result = openSourceFile.ShowDialog(); if (result == System.Windows.Forms.DialogResult.OK) { m_classes.ReadFromFile(openSourceFile.FileName); } DisplayClasses(); } catch (Exception ex) { MessageBox.Show(ex.Message); } } } }
e45b136a68fa8b01a94c8e084f09d89500abd25c
C#
Zuravvski/Mobile-Robots-Project
/robotymobilne_projekt/robotymobilne_projekt/GUI/ViewModels/Manual/ManualViewModel.cs
2.78125
3
using robotymobilne_projekt.GUI.Views.Manual; using System.Collections.ObjectModel; using System.Windows.Input; namespace robotymobilne_projekt.GUI.ViewModels.Manual { public class ManualViewModel : ViewModel { private ICommand addUser; private ICommand removeUser; #region Setters & Getters public int Rows { set; get; } public int Cols { set; get; } public ObservableCollection<UserInterface> Users { get; } #endregion public ManualViewModel() { Users = new ObservableCollection<UserInterface>(); } #region Actions public ICommand AddUser { get { if (null == addUser) { addUser = new DelegateCommand(delegate () { if (Users.Count < 4) { var newUser = new UserInterface {DataContext = new UserViewModel(this)}; Users.Add(newUser); manageLayout(); } }); } return addUser; } } public ICommand RemoveUser { get { if(null == removeUser) { removeUser = new DelegateCommand<RobotViewModel>(delegate (RobotViewModel userVM) { for(int i = 0; i < Users.Count; i++) { if(Users[i].DataContext.Equals(userVM)) { Users.Remove(Users[i]); manageLayout(); } } }); } return removeUser; } } #endregion #region Helper Methods private void manageLayout() { switch (Users.Count) { case 1: Rows = 1; Cols = 1; break; case 2: Rows = 1; Cols = 2; break; case 3: case 4: Rows = 2; Cols = 2; break; default: Rows = 0; Cols = 0; break; } } #endregion } }
5bfed6eeb1caa5c0d931760fa53456978f30ca02
C#
nnaabbcc/exercise
/windows/pw6e.official/CSharp/Chapter14/CustomGradient/CustomGradient/MainPage.xaml.cs
2.703125
3
using System.IO; using System.Runtime.InteropServices.WindowsRuntime; using Windows.UI.Xaml; using Windows.UI.Xaml.Controls; using Windows.UI.Xaml.Media.Imaging; namespace CustomGradient { public sealed partial class MainPage : Page { public MainPage() { this.InitializeComponent(); Loaded += OnMainPageLoaded; } async void OnMainPageLoaded(object sender, RoutedEventArgs args) { WriteableBitmap bitmap = new WriteableBitmap(256, 256); byte[] pixels = new byte[4 * bitmap.PixelWidth * bitmap.PixelHeight]; for (int y = 0; y < bitmap.PixelHeight; y++) for (int x = 0; x < bitmap.PixelWidth; x++) { int index = 4 * (y * bitmap.PixelWidth + x); pixels[index + 0] = (byte)x; // Blue pixels[index + 1] = 0; // Green pixels[index + 2] = (byte)y; // Red pixels[index + 3] = 255; // Alpha } using (Stream pixelStream = bitmap.PixelBuffer.AsStream()) { await pixelStream.WriteAsync(pixels, 0, pixels.Length); } bitmap.Invalidate(); image.Source = bitmap; } } }
414767bcb0dfd76e9b354a7d4e24bd128087c94e
C#
jtarquino/SqlHttpPerf
/Client/SqlClient.cs
2.5625
3
using System; using System.Collections.Generic; using System.Data.SqlClient; using System.Diagnostics; using System.IO; using System.Net.Http; using System.Runtime.Serialization.Formatters.Binary; namespace HttpHandler { public class SqlClient { HttpClient client; private const string openConnection = "https://localhost:5001/SqlClient/OpenConnection"; private const string createCommand = "https://localhost:5001/SqlClient/CreateCommand"; private const string executeReader = "https://localhost:5001/SqlClient/ExecuteReader"; private const string getRows = "https://localhost:5001/SqlClient/GetRows"; private const string getRowsBatch = "https://localhost:5001/SqlClient/GetRowsBatch"; private const string closeReader = "https://localhost:5001/SqlClient/CloseReader"; private const string closeConnection = "https://localhost:5001/SqlClient/CloseConnection"; private const string doNothing= "https://localhost:5001/SqlClient/DoNothing"; public void ReadData() { var sw = new Stopwatch(); client = new HttpClient(); sw.Reset(); sw.Start(); DoNothingThousand(); var result1 = $"Http1 that does nothing: {sw.ElapsedMilliseconds} milliseconds"; client = new HttpClient(new ForceHttp2Handler(new WinHttpHandler())); sw.Reset(); sw.Start(); DoNothingThousand(); var result2 = $"Http2 that does nothing: {sw.ElapsedMilliseconds} milliseconds"; client = new HttpClient(); sw.Reset(); sw.Start(); ReadDataFromHttp(); var result3 = $"Http1: {sw.ElapsedMilliseconds} milliseconds"; client = new HttpClient(new ForceHttp2Handler(new WinHttpHandler())); sw.Reset(); sw.Start(); ReadDataFromHttp(); var result4 = $"Http2: {sw.ElapsedMilliseconds} milliseconds"; sw.Reset(); sw.Start(); ReadDataFromSql(); var result5= $"Sql Native: {sw.ElapsedMilliseconds} milliseconds"; Console.WriteLine(result1); Console.WriteLine(result2); Console.WriteLine(result3); Console.WriteLine(result4); Console.WriteLine(result5); //client = new HttpClient(); //sw.Reset(); //sw.Start(); //ReadDataFromHttpBatch(); //Console.WriteLine($"Http1 Batch: {sw.ElapsedMilliseconds} milliseconds"); } private void ReadDataFromHttp() { for (int i = 0; i < 1000; i++) { Execute(openConnection); Execute(createCommand); Execute(executeReader); Execute(getRows); Execute(closeReader); Execute(closeConnection); if (i % 10 == 0) { Console.WriteLine(i); } } } private void DoNothingThousand() { for (int i = 0; i < 1000; i++) { Execute(doNothing); if (i % 10 == 0) { Console.WriteLine(i); } } } private void ReadDataFromHttpBatch() { for (int i = 0; i < 1000; i++) { Execute(getRowsBatch); Execute(closeReader); Execute(closeConnection); if (i % 10 == 0) { Console.WriteLine(i); } } } private void ReadDataFromSql() { for (int i = 0; i < 1000; i++) { ReadeDataFromSqlOnce(); if (i % 10 == 0) { Console.WriteLine(i); } } } private void ReadeDataFromSqlOnce() { var con = new SqlConnection(ConString.HackyConString); con.Open(); var cmd = con.CreateCommand(); cmd.CommandText = "select top 1 ProductCategoryID FROM [SalesLT].[ProductCategory]"; var dataReader = cmd.ExecuteReader(); var rows = new List<object[]>(); int fieldCount = dataReader.FieldCount; while (dataReader.Read()) { object[] rowValues = new object[fieldCount]; for (int i = 0; i < fieldCount; i++) { rowValues[i] = dataReader.GetValue(i); } rows.Add(rowValues); } byte[] responseBytes = SerializeObjectToBinary(rows); var response = CreateByteArrayResponse(responseBytes); dataReader.Close(); con.Close(); } private void Execute(string url) { HttpResponseMessage response = client.GetAsync(url).GetAwaiter().GetResult(); if (response.IsSuccessStatusCode) { var output = response.Content.ReadAsStringAsync().GetAwaiter().GetResult(); } else { Console.WriteLine($"Error {response.StatusCode} , {response.Content.ReadAsStringAsync().GetAwaiter().GetResult()}"); } } private byte[] SerializeObjectToBinary(object value) { using (var stream = new MemoryStream()) { var formatter = new BinaryFormatter(); formatter.Serialize(stream, value); return stream.ToArray(); } } private HttpResponseMessage CreateByteArrayResponse(byte[] bytes) { HttpResponseMessage response = new HttpResponseMessage(); if (bytes != null) { response.Content = new ByteArrayContent(bytes); } return response; } } }
a0f36551d1c3a9e7143f91ad3e2f0af61a40aa21
C#
marledidiplan/ProyectoWeb
/BLL/ArticuloBLL.cs
2.828125
3
using DAL; using Entidades; using System; using System.Collections.Generic; using System.Data.Entity; using System.Linq; using System.Linq.Expressions; using System.Text; using System.Threading.Tasks; namespace BLL { public class ArticuloBLL { public static bool Guardar(Articulo articulo) { bool paso = false; Contexto contexto = new Contexto(); try { if (contexto.articulos.Add(articulo) != null) { contexto.SaveChanges(); paso = true; } } catch (Exception) { throw; } return paso; } public static bool Modificar(Articulo articulo) { bool paso = false; Contexto contexto = new Contexto(); try { contexto.Entry(articulo).State = EntityState.Modified; if (contexto.SaveChanges() > 0) { paso = true; } contexto.Dispose(); } catch (Exception) { throw; } return paso; } public static Articulo Buscar(int id) { Contexto contexto = new Contexto(); Articulo articulo = new Articulo(); try { articulo = contexto.articulos.Find(id); contexto.Dispose(); } catch (Exception) { throw; } return articulo; } public static bool Eliminar(int id) { bool paso = false; Contexto contexto = new Contexto(); Articulo articulo = new Articulo(); try { articulo = contexto.articulos.Find(id); contexto.articulos.Remove(articulo); if (contexto.SaveChanges() > 0) { paso = true; } } catch (Exception) { throw; } return paso; } public static List<Articulo> GetList(Expression<Func<Articulo, bool>> expression) { Contexto contexto = new Contexto(); List<Articulo> articulos = new List<Articulo>(); try { articulos = contexto.articulos.Where(expression).ToList(); contexto.Dispose(); } catch (Exception) { throw; } return articulos; } public static int CalcularGanancia(int costo, int precio) { int resultado; resultado = precio - costo; resultado = resultado / costo; resultado *= 100; return resultado; } } }
bc3fca1006ba6b2061d0db04c70a166d248044bf
C#
ErtyHackward/utopia
/Utopia/Utopia/Worlds/Chunks/ChunkGraphics.cs
2.703125
3
using System; using System.Collections.Generic; using S33M3DXEngine; using S33M3DXEngine.Buffers; using SharpDX.Direct3D; using SharpDX.Direct3D11; using Utopia.Resources.VertexFormats; namespace Utopia.Worlds.Chunks { /// <summary> /// Contains chunk visual information. Vertices, indices and other graphics stuff /// </summary> public class ChunkGraphics : IDisposable { private readonly VisualChunkBase _parentChunk; private readonly D3DEngine _d3dEngine; private bool _disposed; private bool _ready2Draw; //List are use instead of standard array because it's not possible to know the number of vertices/indices that will be produced at cubes creation time. //After vertex/index buffer creation those collections are cleared. public List<VertexCubeSolid> SolidCubeVertices; // Collection use to collect the vertices at the solid cube creation time public List<ushort> SolidCubeIndices; // Collection use to collect the indices at the solid cube creation time public List<VertexCubeLiquid> LiquidCubeVertices; // Collection use to collect the vertices at the liquid cube creation time public List<ushort> LiquidCubeIndices; // Collection use to collect the indices at the liquid cube creation time //Graphical chunk components Exposed VB and IB ==> Called a lot, so direct acces without property bounding public VertexBuffer<VertexCubeSolid> SolidCubeVB; //Solid cube vertex Buffer public IndexBuffer<ushort> SolidCubeIB; //Solid cube index buffer public VertexBuffer<VertexCubeLiquid> LiquidCubeVB; //Liquid cube vertex Buffer public IndexBuffer<ushort> LiquidCubeIB; //Liquid cube index Buffer /// <summary> /// Desired slice of the mesh /// </summary> public int SliceValue { get; set; } /// <summary> /// Actual slice value of the chunk mesh /// </summary> public int SliceOfMesh { get; set; } /// <summary> /// Whenever the chunk mesh are ready to be rendered to screen /// </summary> public bool IsExistingMesh4Drawing { get { return _ready2Draw; } internal set { if (_ready2Draw != value) { _ready2Draw = value; if (_ready2Draw) _parentChunk.OnReadyToDraw(); //Event raised when the chunk is full ready to be rendered } } } /// <summary> /// Indicates if the chunk is not visible from the camera and therefore should not be rendred /// </summary> public bool IsFrustumCulled { get; set; } /// <summary> /// Gets value indicating if the chunk can and should be rendered /// </summary> public bool NeedToRender { get { return IsExistingMesh4Drawing && !IsFrustumCulled; } } public ChunkGraphics(VisualChunkBase parentChunk, D3DEngine d3DEngine) { SliceValue = -1; _parentChunk = parentChunk; _d3dEngine = d3DEngine; } public void InitializeChunkBuffers() { SolidCubeVertices = new List<VertexCubeSolid>(); SolidCubeIndices = new List<ushort>(); LiquidCubeVertices = new List<VertexCubeLiquid>(); LiquidCubeIndices = new List<ushort>(); } public void SendCubeMeshesToBuffers() { if (_disposed) return; SendSolidCubeMeshToGraphicCard(); //Solid Cubes SendLiquidCubeMeshToGraphicCard(); //See Through Cubes _parentChunk.State = ChunkState.DisplayInSyncWithMeshes; IsExistingMesh4Drawing = true; SliceOfMesh = SliceValue; } //Solid Cube //Create the VBuffer + IBuffer from the List, then clear the list //The Buffers are pushed to the graphic card. (SetData()); private void SendSolidCubeMeshToGraphicCard() { if (SolidCubeVertices.Count == 0) { if (SolidCubeVB != null) SolidCubeVB.Dispose(); SolidCubeVB = null; return; } if (SolidCubeVB == null) { SolidCubeVB = new VertexBuffer<VertexCubeSolid>(_d3dEngine.Device, SolidCubeVertices.Count, PrimitiveTopology.TriangleList, "SolidCubeVB", ResourceUsage.Default, 10); } SolidCubeVB.SetData(_d3dEngine.ImmediateContext, SolidCubeVertices.ToArray()); SolidCubeVertices.Clear(); if (SolidCubeIB == null) { SolidCubeIB = new IndexBuffer<ushort>(_d3dEngine.Device, SolidCubeIndices.Count, "SolidCubeIB"); } SolidCubeIB.SetData(_d3dEngine.ImmediateContext, SolidCubeIndices.ToArray()); SolidCubeIndices.Clear(); } //Liquid Cube //Create the VBuffer + IBuffer from the List, then clear the list //The Buffers are pushed to the graphic card. (SetData()); private void SendLiquidCubeMeshToGraphicCard() { if (LiquidCubeVertices.Count == 0) { if (LiquidCubeVB != null) LiquidCubeVB.Dispose(); LiquidCubeVB = null; return; } if (LiquidCubeVB == null) { LiquidCubeVB = new VertexBuffer<VertexCubeLiquid>(_d3dEngine.Device, LiquidCubeVertices.Count, PrimitiveTopology.TriangleList, "LiquidCubeVB", ResourceUsage.Default, 10); } LiquidCubeVB.SetData(_d3dEngine.ImmediateContext, LiquidCubeVertices.ToArray()); LiquidCubeVertices.Clear(); if (LiquidCubeIB == null) { LiquidCubeIB = new IndexBuffer<ushort>(_d3dEngine.Device, LiquidCubeIndices.Count, "LiquidCubeIB"); } LiquidCubeIB.SetData(_d3dEngine.ImmediateContext, LiquidCubeIndices.ToArray()); LiquidCubeIndices.Clear(); } //Ask the Graphical card to Draw the solid faces public void DrawSolidFaces(DeviceContext context) { if (_disposed) return; if (SolidCubeVB != null) { SolidCubeVB.SetToDevice(context, 0); SolidCubeIB.SetToDevice(context, 0); context.DrawIndexed(SolidCubeIB.IndicesCount, 0, 0); } } //Ask the Graphical card to Draw the solid faces public void DrawLiquidFaces(DeviceContext context) { if (_disposed) return; if (LiquidCubeVB != null) { LiquidCubeVB.SetToDevice(context, 0); LiquidCubeIB.SetToDevice(context, 0); context.DrawIndexed(LiquidCubeIB.IndicesCount, 0, 0); } } public void Dispose() { if (SolidCubeVB != null) SolidCubeVB.Dispose(); if (SolidCubeIB != null) SolidCubeIB.Dispose(); if (LiquidCubeVB != null) LiquidCubeVB.Dispose(); if (LiquidCubeIB != null) LiquidCubeIB.Dispose(); _disposed = true; } } }
558642157ba05c005ce7315cedbf538cbb6e062a
C#
CodeMazeBlog/string-concatenation-csharp
/StringDemo/StringConcatenationExamples.cs
3.421875
3
using System; using System.Diagnostics; using System.Text; namespace StringDemo { public class StringConcatenationExamples { private static readonly string _foo = "Morning!"; private static readonly string _bar = "Nice day for fishing, ain't it?"; private static readonly string _result = "Morning! Nice day for fishing, ain't it?"; private readonly string[] _foobar = { _foo, _bar }; private static readonly string _assertFailedMessage = "Not equal!"; public void CheckResult() { Debug.Assert(_result.Equals(Plus(_foo, _bar)), _assertFailedMessage); Debug.Assert(_result.Equals(PlusEquals(_foo, " ", _bar)), _assertFailedMessage); Debug.Assert(_result.Equals(Format(_foo, _bar)), _assertFailedMessage); Debug.Assert(_result.Equals(Concat(_foo, _bar)), _assertFailedMessage); Debug.Assert(_result.Equals(Join(_foo, _bar)), _assertFailedMessage); Debug.Assert(_result.Equals(StringBuilder(_foo, _bar)), _assertFailedMessage); } // Example 1: + Operator public string Plus(params string[] values) { return _foo + " " + _bar; } // Example 2: += Operator public string PlusEquals(params string[] values) { string plusEqualsResult = String.Empty; for (var index = 0; index < values.Length; index++) { plusEqualsResult += values[index]; } return plusEqualsResult; } // Example 3: String.Format() public string Format(params string[] values) { return String.Format("{0} {1}", _foo, _bar); } // Example 4: String.Concatenate() with values public string Concat(params string[] values) { return String.Concat(_foo, " ", _bar); } // Example 5: Interpolation (C# 6 feature) public string Interpolation(params string[] values) { return $"{_foo} {_bar}"; } //Example 6: String.Join() public string Join(params string[] values) { return String.Join(" ", _foobar); } //Example 7: StringBuilder.Append() public string StringBuilder(params string[] values) { StringBuilder stringBuilder = new StringBuilder(); stringBuilder.Append(_foo); stringBuilder.Append(" "); stringBuilder.Append(_bar); return stringBuilder.ToString(); } } }
f7d31f5f79ba9ccae0a2fba3d70153f6cdab9cf3
C#
metodiev/Telerik-Academy
/First Semester/Csharp Part 1/Test and Exam/Projects/7. Test Preparation and Exam/FirTree/FirTree.cs
3.75
4
using System; //Input: //The input data should be read from the console. //On the only input line you have an integer number N, showing the height of the tree. //The input data will always be valid and in the format described. There is no need to check it explicitly. //Output: //The output data should be printed on the console. //You must print the fir tree on the console. Each row contains only characters "." (point) or "*" (asterisk). //The first row should have exactly one "*" in the middle (that is the top of the tree) and each of the next lines two more. //The last line should have exactly one asterisk in the middle, showing the stem of the tree. //Constraints: //The number N is a positive integer between 4 and 100, inclusive. class FirTree { static void Main() { int N = int.Parse(Console.ReadLine()); int count = 2; int countNext = 1; for (int i = 0; i < N - 1; countNext+=2,count+=1,i++) { for (int p = 0; p < N - count; p++) { Console.Write("."); } for (int q = 0; q < countNext; q++) { Console.Write("*"); } for (int j = 0; j < N - count; j++) { Console.Write("."); } Console.WriteLine(); } for (int i = 0; i < N - 2; i++) { Console.Write("."); } Console.Write("*"); for (int i = 0; i < N - 2; i++) { Console.Write("."); } } }
9f9bcb18d17a2bfab3773368d109c66d80fb8db1
C#
dotnet/dotnet-api-docs
/snippets/csharp/System.Web.Services.Description/MessagePart/Message/messagepartcollection.cs
3.078125
3
// System.Web.Services.Description.MessagePartCollection.Item Property(Int32); // System.Web.Services.Description.MessagePart.Message; // System.Web.Services.Description.MessagePartCollection.CopyTo; // System.Web.Services.Description.MessagePartCollection.Item Property (String); // System.Web.Services.Description.MessagePartCollection.Contains; // System.Web.Services.Description.MessagePartCollection.IndexOf; // System.Web.Services.Description.MessagePartCollection.Remove; // System.Web.Services.Description.MessagePartCollection; /* The program reads a wsdl document "MathService.wsdl" and gets ServiceDescription instance. A MessagePartCollection instance is then retrieved from each Message and it's members are demonstrated. */ // <Snippet8> using System; using System.Web.Services.Description; using System.Collections; using System.Xml; class MyClass1 { public static void Main() { Console.WriteLine(""); Console.WriteLine("MessagePartCollection Sample"); Console.WriteLine("============================"); Console.WriteLine(""); ServiceDescription myServiceDescription = ServiceDescription.Read("MathService.wsdl"); // Get the message collection. MessageCollection myMessageCollection = myServiceDescription.Messages; Console.WriteLine("Total Messages in the document = " + myServiceDescription.Messages.Count); Console.WriteLine(""); Console.WriteLine("Enumerating PartCollection for each message..."); Console.WriteLine(""); // <Snippet1> // <Snippet2> // Get the message part collection for each message. for(int i =0; i < myMessageCollection.Count; ++i) { Console.WriteLine("Message : " + myMessageCollection[i].Name); // Get the message part collection. MessagePartCollection myMessagePartCollection = myMessageCollection[i].Parts; // Display the part collection. for(int k = 0; k < myMessagePartCollection.Count;k++) { Console.WriteLine("\t Part Name : " + myMessagePartCollection[k].Name); Console.WriteLine("\t Message Name : " + myMessagePartCollection[k].Message.Name); } Console.WriteLine(""); } // </Snippet2> // </Snippet1> Console.WriteLine("Displaying the array copied from the " + "MessagePartCollection for the message AddHttpGetIn."); // <Snippet3> // <Snippet4> Message myLocalMessage = myServiceDescription.Messages["AddHttpPostOut"]; if (myMessageCollection.Contains(myLocalMessage)) { Console.WriteLine("Message : " + myLocalMessage.Name); // Get the message part collection. MessagePartCollection myMessagePartCollection = myLocalMessage.Parts; MessagePart[] myMessagePart = new MessagePart[myMessagePartCollection.Count]; // Copy the MessagePartCollection to an array. myMessagePartCollection.CopyTo(myMessagePart,0); for(int k = 0; k < myMessagePart.Length; k++) { Console.WriteLine("\t Part Name : " + myMessagePartCollection[k].Name); } Console.WriteLine(""); } // </Snippet4> // </Snippet3> // <Snippet5> // <Snippet6> // <Snippet7> Console.WriteLine("Checking if message is AddHttpPostOut..."); Message myMessage = myServiceDescription.Messages["AddHttpPostOut"]; if (myMessageCollection.Contains(myMessage)) { // Get the message part collection. MessagePartCollection myMessagePartCollection = myMessage.Parts; // Get the part named Body. MessagePart myMessagePart = myMessage.Parts["Body"]; if (myMessagePartCollection.Contains(myMessagePart)) { // Get the index of the part named Body. Console.WriteLine("Index of Body in MessagePart collection = " + myMessagePartCollection.IndexOf(myMessagePart)); Console.WriteLine("Deleting Body from MessagePart collection..."); myMessagePartCollection.Remove(myMessagePart); if(myMessagePartCollection.IndexOf(myMessagePart)== -1) { Console.WriteLine("MessagePart Body successfully deleted " + "from the message AddHttpPostOut."); } } } // </Snippet7> // </Snippet6> // </Snippet5> } } // </Snippet8>
451c47ab14591204896b9dd37ac67b8516be5d99
C#
CarlSargunar/Developer-Test
/MVC Test/Classes/Alert.cs
2.828125
3
using System; using System.Collections.Generic; using System.Linq; using System.Web; using System.Web.Mvc; namespace MVC_Test.Classes { public class Alert : IHtmlString { public enum AlertStatus { Success, Danger, Info, Warning } private readonly bool _dismissable; public Alert(string message, bool dismissable = true) { _dismissable = dismissable; Message = message; } public string Message { get; private set; } public AlertStatus Status { get; set; } public string ToHtmlString() { var tag = new TagBuilder("div"); var innerTag = new TagBuilder("div"); var button = new TagBuilder("button"); button.AddCssClass("close"); button.MergeAttribute("data-dismiss", "alert"); button.MergeAttribute("aria-hidden", "true"); button.InnerHtml = "&times;"; tag.AddCssClass("alert"); innerTag.AddCssClass("alert-inner"); switch (Status) { case AlertStatus.Success: tag.AddCssClass("alert-success"); break; case AlertStatus.Warning: tag.AddCssClass("alert-warning"); break; case AlertStatus.Danger: tag.AddCssClass("alert-danger"); break; case AlertStatus.Info: tag.AddCssClass("alert-info"); break; } if (_dismissable) { tag.AddCssClass("alert-dismissable"); tag.InnerHtml = button.ToString(); } innerTag.InnerHtml += Message; tag.InnerHtml += innerTag; return tag.ToString(); } } }
5481883b94b9f40c6314fff8a8587888e555540a
C#
aktauseef/Expense_Manager
/DAL/DataClasses/CategoryDAL.cs
3.046875
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; using Models; namespace DAL.DataClasses { public class CategoryDAL { public int AddCategory(Models.Category Category) { int result = 0; using(var db =new Expense_ManagerEntities()) { if (Category.category_name != null) { category cat = new category(); cat.category_name = Category.category_name; cat.user_id = Category.user_id; if (IsCategoryExist(cat)) return 2; db.category.Add(cat); db.SaveChanges(); result = 1; } } return result; } public bool IsCategoryExist(category Category) { bool result; using (var db = new Expense_ManagerEntities()) { category cat = new category(); result= db.category.Where(x => x.category_name == Category.category_name && x.user_id == Category.user_id).Any(); } return result; } public List<Category> GetCategoryList(string userid) { List<Category> catListModel=new List<Category>(); if (userid != null) { using (var db = new Expense_ManagerEntities()) { int id = int.Parse(userid); int count = db.category.Where(m => m.user_id == id).Count(); List<category> catListDAL = new List<category>(); catListDAL = db.category.Where(m => m.user_id ==id).ToList(); foreach (var item in catListDAL) { Category catModel = new Category(); catModel.id = item.id; catModel.category_name = item.category_name; catModel.user_id = item.user_id; catListModel.Add(catModel); } catListModel.Reverse(); //i am reversing it to display the latest added data on top } } return catListModel; } public int DeleteCategory(int ctgryId) { int result = 0; if (ctgryId > 0) { using (var db = new Expense_ManagerEntities()) { var a = db.category.Find(ctgryId); db.category.Remove(a); db.SaveChanges(); result = 1; } } return result; } public int EditCategory(int id,string name) { int result = 0; if (id>0 && name!=null) { using (var db = new Expense_ManagerEntities()) { var a = db.category.FirstOrDefault(x=>x.id==id); if (a != null) { a.category_name = name; db.SaveChanges(); result = 1; } } } return result; } } }
2ac510eccd74fbf34dc404a8f642c262b815954d
C#
peterhumbert/JournalIndexExcel
/JournalIndexMaker/JournalIndexMaker/Subcategory.cs
3.140625
3
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace JournalIndexMaker { class Subcategory { private string Name { get; set; } private List<DateTime> Entries = new List<DateTime>(); public Subcategory(string Name) { this.Name = Name; } public Subcategory(string Name, DateTime dt) : this(Name) { Entries.Add(dt); } public void addEntry(DateTime dt) { if (!Entries.Contains(dt)) { Entries.Add(dt); } } public List<DateTime> getEntries() { Entries.Sort(); return Entries; } } }
26f9c4d5cddfc2c7e621b272f91541eeebf373ec
C#
nikitagru/ListPoker
/View/GameLabel.cs
2.953125
3
using System; using System.Collections.Generic; using System.Drawing; using System.Text; using System.Windows.Forms; namespace ListPoker.View { class GameLabel { public Label DrawNames(string name, int positionIteration) { Label label = new Label(); label.Text = name; label.Font = MainFont.font; label.Location = new Point(TableInfo.firstColumnWidth + TableInfo.secondColumnWidth + positionIteration * TableInfo.playerColumnWidth + TableInfo.secondRowHeight, 0); return label; } public Label DrawNameDistrib(string name, int positionIteration) { Label label = new Label(); label.Text = name; label.Font = MainFont.font; label.Location = new Point(TableInfo.firstColumnWidth + 20, TableInfo.firstRowHeight + TableInfo.secondRowHeight + positionIteration * TableInfo.roundRowHeight + 5); return label; } public Label CardCount(int counter, int positionIteration) { Label label = new Label(); label.Text = counter.ToString(); label.Font = MainFont.font; label.Location = new Point(20, TableInfo.firstRowHeight + TableInfo.secondRowHeight + positionIteration * TableInfo.roundRowHeight + 5); return label; } public Label PlayerInfo(int positionIteration, string info, int currentPlayer) { Label label = new Label(); label.Font = MainFont.playerInfo; label.Text = info; label.Size = new Size(69, 20); label.Location = new Point(TableInfo.firstColumnWidth + TableInfo.secondColumnWidth + currentPlayer * TableInfo.playerColumnWidth + TableInfo.playerInfoColumnWidth * positionIteration + 15, TableInfo.roundRowHeight); return label; } public Label PlayerScore(int score, int currentPlayerPosition, int currentStep) { Label label = new Label(); label.Font = MainFont.font; label.Text = score.ToString(); label.Location = new Point(TableInfo.firstColumnWidth + TableInfo.secondColumnWidth + currentPlayerPosition * TableInfo.playerColumnWidth - TableInfo.playerInfoColumnWidth, TableInfo.firstRowHeight + TableInfo.secondRowHeight + (currentStep - 1) * TableInfo.roundRowHeight); return label; } } }
497314199816f2bbf4ccf15edcafb50037846413
C#
IonutDjonIancu/myCSharpWork
/GuessGame.cs
3.5
4
using System; using System.Collections.Generic; using System.Linq; using System.Text; using System.Threading.Tasks; namespace ConsoleApp1 { class GuessGame { static void Main(string[] args) { string secretMessage = "apothecary"; string guess = null; int guessCounter = 4; do { Console.Write("guess the word: "); guess = Console.ReadLine(); guessCounter--; } while (guess != secretMessage && guessCounter>0); if (guess.Equals(secretMessage)) { Console.WriteLine("You win!"); } else { Console.WriteLine("You lose!"); } Console.ReadLine(); } } }
ceb091299f801aa34afed925383e49dceddc6c8e
C#
TihomirTE/TelerikAcademy
/C Sharp/03. C# OOP/05. OOP-Principles-Part-2/BankAccounts/Accounts/LoanAccount.cs
3.265625
3
namespace BankAccounts.Accounts { using System; using BankAccounts.Customers; using BankAccounts.Interfaces; class LoanAccount : Account, IAcounts, IDeposit { // constructor public LoanAccount(Customer customer, decimal balance, decimal interestRate) : base(customer, balance, interestRate) { } // calculation method public override decimal CalculateInterest(int months) { if (months <= 0) { throw new ArgumentException("Montths must be positive value"); } if (this.Customer.CustomerType == CustomerType.Company && months <= 2) { return 0; } if (this.Customer.CustomerType == CustomerType.Individual && months <= 3) { return 0; } return base.CalculateInterest(months); } } }
64a0fd07115ca5686e1b62482356ca9fbf57a778
C#
jerhemy/DesignPatterns
/Prototype/Mob.cs
3.34375
3
namespace Prototype { abstract class MobPrototype { public abstract MobPrototype Clone(); } class Mob : MobPrototype { public string Name { get; } public int HP { get; } public Mob(string name, int hp) { Name = name; HP = hp; } public override MobPrototype Clone() { return MemberwiseClone() as MobPrototype; } } }
a944797556c437b1fe763c930f1961f652ab452c
C#
EusebioDM/Fixture-System
/BackEnd/SilverFixture.Domain/Users/User.cs
2.6875
3
using System; using System.Collections.Generic; using SilverFixture.Domain.Fixture; namespace SilverFixture.Domain.User { public class User { public Role Role { get; set; } private ICollection<Team> followedTeams; public User() { followedTeams = new List<Team>(); } public User(string userName) : this() { UserName = userName; } public User(Role role, string userName, string name, string surname, string password, string mail) : this(userName) { Name = name; Surname = surname; Password = password; Mail = mail; Role = role; } public User(Role role, string userName, string name, string surname, string password, string mail, ICollection<Team> followedTeams) : this(role, userName, name, surname, password, mail) { this.followedTeams = followedTeams; } public NonEmptyString UserName { get; set; } public Name Name { get; set; } public Name Surname { get; set; } public NonEmptyString Password { get; set; } public Mail Mail { get; set; } public void AddFollowedTeam(Team team) { followedTeams.Add(team); } public void RemoveFollowedTeam(Team team) { followedTeams.Remove(team); } public IEnumerable<Team> FollowedTeams => followedTeams; public override bool Equals(object obj) { var user = obj as User; return user != null && UserName == user.UserName; } public override int GetHashCode() { return -1424944255 + EqualityComparer<string>.Default.GetHashCode(UserName); } } }